Field | Sense | Antisense |
siRNA chemical modification | 2-Hydroxyethyl 2,3,4,6-tetra-O-Methyl-b-D-Glucopyranoside | 0 |
siRNA modification types | 1 | 0 |
Overall number of modifications | 1 | 0 |
Position of modifications | 1 | 0 |
Modification on sugar or base or phosphate | Phosphate | 0 |
SMILES (Click to view structure & nomenclature) |
COC1OC(OCCOP(O)([O-])=O)C(OC)C(OC)C1OC |
- |
siRNA Sequence | AUCUGAAGAAGGAGAAAAATT | UUUUUCUCCUUCUUCAGAUTT |
siRNA length base-pair | 21 | 21 |
siRNA name in paper | 1 | 1 |
Biological activity | 91 percent target mRNA inhibition | |
Experiment used to check activity | Luciferase reporter assay | |
Melting temperature (oC) | NA | |
Target gene | Luciferase gene | |
siRNA concentration | 0.8 nM | |
Cell or Organism used | HeLa and HuH-cells | |
Transfection method | Lipofectamine 2003 | |
Duration after transfection | 24 Hours | |
Article title | Synthesis, RNAi activity and nuclease-resistant properties of apolar carbohydrates siRNA conjugates |
|
Reference | 23764303 |