| Field | Sense | Antisense |
| siRNA chemical modification | Thymidine analogue | Thymidine analogue |
| siRNA modification types | 1 | 1 |
| Overall number of modifications | 1 | 1 |
| Position of modifications | 21 | 21 |
| Modification on sugar or base or phosphate | Base | Base |
| SMILES (Click to view structure & nomenclature) |
CC1=CN(CC2OC(OCCOP(O)([O-])=O)C(N)C(O)C2O)C(=O)NC1=O |
CC1=CN(CC2OC(OCCOP(O)([O-])=O)C(N)C(O)C2O)C(=O)NC1=O |
| siRNA Sequence | CUUCUUCGUCGAGACCAUGTX | CAUGGUCUCGACGAAGAAGTX |
| siRNA length base-pair | 21 | 21 |
| siRNA name in paper | siRNA 24 | siRNA 24 |
| Biological activity | 34 percent target mRNA inhibition | |
| Experiment used to check activity | Dual luciferase reporter assay | |
| Melting temperature (oC) | 75.5 | |
| Target gene | Luciferase gene | |
| siRNA concentration | 1 nM | |
| Cell or Organism used | HeLa cells | |
| Transfection method | TransFast (Promega) | |
| Duration after transfection | 24 Hours | |
| Article title | Synthesis of oligonucleotides with glucosamine at the 3'-position and evaluation of their biological activity |
|
| Reference | 23743279 | |