| Field | Sense | Antisense |
| siRNA chemical modification | L-Isonucleoside adenosine* 2-Deoxythymidine | 2-Deoxythymidine |
| siRNA modification types | 2 | 1 |
| Overall number of modifications | 3 | 2 |
| Position of modifications | 8* 20,21 | 20,21 |
| Modification on sugar or base or phosphate | Base | Sugar |
| SMILES (Click to view structure & nomenclature) |
NC1=C2N=CN(C3COC(CO)C3OP(O)([O-])=O)C2=NC=N1 CC1=CN(C2CC(O)C(CO)O2)C(=O)NC1=O |
OCC1OCCC1O |
| siRNA Sequence | GCAACUCAUGGUUCAUGCUTT | AGCAUGAACCAUGAGUUGCTT |
| siRNA length base-pair | 21 | 21 |
| siRNA name in paper | siMek1-S08L | siMek1-S08L |
| Biological activity | 22 percent target mRNA inhibition | |
| Experiment used to check activity | Dual luciferase reporter assay | |
| Melting temperature (oC) | 54.4 | |
| Target gene | MEK1 gene | |
| siRNA concentration | 10 nM | |
| Cell or Organism used | HEK293 cells | |
| Transfection method | Lipofectamine 2000 | |
| Duration after transfection | 24 Hours | |
| Article title | Effects of conformational alteration induced by D-/L-isonucleoside incorporation in siRNA on their stability in serum and silencing activity |
|
| Reference | 23682837 | |