| Field | Sense | Antisense |
| siRNA chemical modification | 2-Deoxythymidine | D-Isonucleoside uracil* 2-Deoxythymidine |
| siRNA modification types | 1 | 2 |
| Overall number of modifications | 2 | 3 |
| Position of modifications | 20,21 | 5* 20,21 |
| Modification on sugar or base or phosphate | Sugar | Nucleoside |
| SMILES (Click to view structure & nomenclature) |
CC1=CN(C2CC(O)C(CO)O2)C(=O)NC1=O |
OCC1OCC(C1OP(O)([O-])=O)N1C=CC(=O)NC1=O CC1=CN(C2CC(O)C(CO)O2)C(=O)NC1=O |
| siRNA Sequence | GCAACUCAUGGUUCAUGCUTT | AGCAUGAACCAUGAGUUGCTT |
| siRNA length base-pair | 21 | 21 |
| siRNA name in paper | siMek1-A05D | siMek1-A05D |
| Biological activity | 27 percent target mRNA inhibition | |
| Experiment used to check activity | Dual luciferase reporter assay | |
| Melting temperature (oC) | 58.7 | |
| Target gene | MEK1 gene | |
| siRNA concentration | 10 nM | |
| Cell or Organism used | HEK293 cells | |
| Transfection method | Lipofectamine 2000 | |
| Duration after transfection | 24 Hours | |
| Article title | Effects of conformational alteration induced by D-/L-isonucleoside incorporation in siRNA on their stability in serum and silencing activity |
|
| Reference | 23682837 | |