| Field | Sense | Antisense |
| siRNA chemical modification | Boron cluster | 0 |
| siRNA modification types | 1 | 0 |
| Overall number of modifications | 1 | 0 |
| Position of modifications | 3 | 0 |
| Modification on sugar or base or phosphate | Base | 0 |
| SMILES (Click to view structure & nomenclature) |
[B]1234[B]567[B]118[B]229[B]11%10[B]22%11[B]%12%13%14[B]35([B]6%123[B]12%13[C]78%103)[C]49%11%14 |
- |
| siRNA Sequence | AATCAGACAAGUUCUUCAUTT | AUGAAGAACUUGUCUGAUUTT |
| siRNA length base-pair | 21 | 21 |
| siRNA name in paper | (CB3) s | as |
| Biological activity | 83 percent target mRNA inhibition | |
| Experiment used to check activity | Dual fluorescence assay | |
| Melting temperature (oC) | 64.0 ±0.2 | |
| Target gene | BACE1 gene | |
| siRNA concentration | 0.1 nM | |
| Cell or Organism used | HeLa cells | |
| Transfection method | Lipofectamine 2000 | |
| Duration after transfection | 24 Hours | |
| Article title | siRNAs modified with boron cluster and their physicochemical and biological characterization |
|
| Reference | 23682800 | |