| Field | Sense | Antisense |
| siRNA chemical modification | 0 | Boron cluster |
| siRNA modification types | 0 | 1 |
| Overall number of modifications | 0 | 1 |
| Position of modifications | 0 | 20 |
| Modification on sugar or base or phosphate | 0 | Base |
| SMILES (Click to view structure & nomenclature) |
- |
[B]1234[B]567[B]118[B]229[B]11%10[B]22%11[B]%12%13%14[B]35([B]6%123[B]12%13[C]78%103)[C]49%11%14 |
| siRNA Sequence | AAUCAGACAAGUUCUUCAUTT | AUGAAGAACUUGUCUGAUUTT |
| siRNA length base-pair | 21 | 21 |
| siRNA name in paper | s | (CB20)as |
| Biological activity | 85 percent target mRNA inhibition | |
| Experiment used to check activity | Dual fluorescence assay | |
| Melting temperature (oC) | 63.9 ±0.0 | |
| Target gene | BACE1 gene | |
| siRNA concentration | 0.1 nM | |
| Cell or Organism used | HeLa cells | |
| Transfection method | Lipofectamine 2000 | |
| Duration after transfection | 24 Hours | |
| Article title | siRNAs modified with boron cluster and their physicochemical and biological characterization |
|
| Reference | 23682800 | |