| Field | Sense | Antisense |
| siRNA chemical modification | N4-Ethyl-N4 2-Deoxy-5-Methylcytidine | 0 |
| siRNA modification types | 1 | 0 |
| Overall number of modifications | 1 | 0 |
| Position of modifications | 2 | 0 |
| Modification on sugar or base or phosphate | Base | 0 |
| SMILES (Click to view structure & nomenclature) |
CC1=CN(C2CC(O)C(CO)O2)C(=O)N=C1NCCNC1=NC(=O)N(C=C1C)C1CC(O)C(CO)O1 |
- |
| siRNA Sequence | AUCUGAAGAAGGAGAAAAAC | UUUUUCUCCUUCUUCAGAUTT |
| siRNA length base-pair | 20 | 21 |
| siRNA name in paper | II | II |
| Biological activity | IC-50 = 0.013 nM for target mRNA | |
| Experiment used to check activity | PAGE non-denaturating | |
| Melting temperature (oC) | 60.9 | |
| Target gene | Luciferase gene | |
| siRNA concentration | 0.013 nM | |
| Cell or Organism used | SH-SY5Y and MCF-7 cells | |
| Transfection method | Lipofectamine 2000 | |
| Duration after transfection | 24 Hours | |
| Article title | Functionalization of the 3'-ends of DNA and RNA strands with N-ethyl-N-coupled nucleosides: a promising approach to avoid 3'-exonuclease-catalyzed hydrolysis of therapeutic oligonucleotides |
|
| Reference | 23362010 | |