Field | Sense | Antisense |
siRNA chemical modification | 2-Deoxythymidine | 2-Deoxythymidine |
siRNA modification types | 1 | 1 |
Overall number of modifications | 2 | 2 |
Position of modifications | 22,23 | 22,23 |
Modification on sugar or base or phosphate | Sugar | Sugar |
SMILES (Click to view structure & nomenclature) |
CC1=CN(C2CC(O)C(CO)O2)C(=O)NC1=O |
OCC1OCCC1O |
siRNA Sequence | CGUUAGCAGAAACAAAAGGAGTT | CUCCUUUUGUUUCUGCUAACGTT |
siRNA length base-pair | 23 | 23 |
siRNA name in paper | PTEN1A | PTEN1B |
Biological activity | High target mRNA inhibition efficacy | |
Experiment used to check activity | Real-time PCR | |
Melting temperature (oC) | NA | |
Target gene | Human PTEN gene | |
siRNA concentration | 1 to 40 nM | |
Cell or Organism used | HeLa cells | |
Transfection method | Oligofectamine (Invitrogen) | |
Duration after transfection | 48 Hours | |
Article title | Structural variations and stabilising modifications of synthetic siRNAs in mammalian cells |
|
Reference | 12771196 |