| Field | Sense | Antisense |
| siRNA chemical modification | 2-Deoxythymidine | 2-Deoxythymidine |
| siRNA modification types | 1 | 1 |
| Overall number of modifications | 2 | 2 |
| Position of modifications | 1,2 | 1,2 |
| Modification on sugar or base or phosphate | Sugar | Sugar |
| SMILES (Click to view structure & nomenclature) |
CC1=CN(C2CC(O)C(CO)O2)C(=O)NC1=O |
OCC1OCCC1O |
| siRNA Sequence | TTCGUUAGCAGAAACAAAAGGAG | TTCUCCUUUUGUUUCUGCUAACG |
| siRNA length base-pair | 23 | 23 |
| siRNA name in paper | PTEN3A | PTEN3B |
| Biological activity | High target mRNA inhibition efficacy | |
| Experiment used to check activity | Real-time PCR | |
| Melting temperature (oC) | NA | |
| Target gene | Human PTEN gene | |
| siRNA concentration | 1 to 40 nM | |
| Cell or Organism used | HeLa cells | |
| Transfection method | Oligofectamine (Invitrogen) | |
| Duration after transfection | 48 Hours | |
| Article title | Structural variations and stabilising modifications of synthetic siRNAs in mammalian cells |
|
| Reference | 12771196 | |