| Field | Sense | Antisense |
| siRNA chemical modification | 2-Deoxythymidine (Mutation) | 2-Deoxythymidine (Mutation) |
| siRNA modification types | 1 | 1 |
| Overall number of modifications | 2 | 2 (4) |
| Position of modifications | 20,21 (1,19) | 20,21 (1,19) |
| Modification on sugar or base or phosphate | Sugar (Base) | Sugar (Base) |
| SMILES (Click to view structure & nomenclature) |
CC1=CN(C2CC(O)C(CO)O2)C(=O)NC1=O |
OCC1OCCC1O |
| siRNA Sequence | GGAGGGGAGUACAUCAAGUTT | ACUUGAUGUACUCCCCUCCTT |
| siRNA length base-pair | 21 | 21 |
| siRNA name in paper | Akt1 6A | Akt1 6B |
| Biological activity | High target mRNA inhibition efficacy | |
| Experiment used to check activity | Real-time PCR | |
| Melting temperature (oC) | NA | |
| Target gene | Akt gene | |
| siRNA concentration | 1 to 40 nM | |
| Cell or Organism used | HeLa cells | |
| Transfection method | Oligofectamine (Invitrogen) | |
| Duration after transfection | 48 Hours | |
| Article title | Structural variations and stabilising modifications of synthetic siRNAs in mammalian cells |
|
| Reference | 12771196 | |