| Field | Sense | Antisense |
| siRNA chemical modification | 0 | 2,4-Difluorotoluene |
| siRNA modification types | 0 | 1 |
| Overall number of modifications | 0 | 1 |
| Position of modifications | 0 | 9 |
| Modification on sugar or base or phosphate | 0 | Base |
| SMILES (Click to view structure & nomenclature) |
- |
CC1=CC(CC2OC(CO)C(O)C2O)=C(F)C=C1F |
| siRNA Sequence | CUUACGCUGAGUACUUCGATT | UCGAAGUACUCAGCGUAAGTT |
| siRNA length base-pair | 21 | 21 |
| siRNA name in paper | V | V |
| Biological activity | IC-50 (Less than than 30 nM) for target mRNA | |
| Experiment used to check activity | Luciferase mRNA Expression analysis | |
| Melting temperature (oC) | NA | |
| Target gene | Luciferase gene | |
| siRNA concentration | 0.4 to 30 nM | |
| Cell or Organism used | HeLa cells | |
| Transfection method | Lipofectamine 2000 | |
| Duration after transfection | 24 Hours | |
| Article title | Gene silencing activity of siRNAs with a ribo-difluorotoluyl nucleotide |
|
| Reference | 17163665 | |