Field | Sense | Antisense |
siRNA chemical modification | 0 | Difluorotoluyl nucleotide |
siRNA modification types | 0 | 1 |
Overall number of modifications | 0 | 1 |
Position of modifications | 0 | 9 |
Modification on sugar or base or phosphate | 0 | Base |
SMILES (Click to view structure & nomenclature) |
- |
CC1=CC(C2OC(CO)C(O)C2O)=C(F)C=C1F |
siRNA Sequence | CUUACGCUGAGUACUUCGATT | UCGAAGUACUCAGCGUAAGTT |
siRNA length base-pair | 21 | 21 |
siRNA name in paper | AL-1 | AL-9 |
Biological activity | 5 percent target mRNA inhibition | |
Experiment used to check activity | Dual luciferase reporter assay | |
Melting temperature (oC) | NA | |
Target gene | Luciferase gene | |
siRNA concentration | 10 nM | |
Cell or Organism used | HeLa cells | |
Transfection method | Lipofectamine 2000 | |
Duration after transfection | 24 Hours | |
Article title | Crystal structure, stability and in vitro RNAi activity of oligoribonucleotides containing the ribo-difluorotoluyl nucleotide: insights into substrate requirements by the human RISC Ago2 enzyme |
|
Reference | 17881374 |