| Field | Sense | Antisense |
| siRNA chemical modification | 0 | Difluorotoluyl nucleotide |
| siRNA modification types | 0 | 1 |
| Overall number of modifications | 0 | 3 |
| Position of modifications | 0 | 10,11,12 |
| Modification on sugar or base or phosphate | 0 | Base |
| SMILES (Click to view structure & nomenclature) |
- |
CC1=CC(C2OC(CO)C(O)C2O)=C(F)C=C1F |
| siRNA Sequence | GCGGAUCAAACCUCACCAATT | UUGGUGAGGUUUGAUCCGCTT |
| siRNA length base-pair | 21 | 22 |
| siRNA name in paper | AL-18 | AL-16 |
| Biological activity | 28 percent target mRNA inhibition | |
| Experiment used to check activity | Dual luciferase reporter assay | |
| Melting temperature (oC) | NA | |
| Target gene | Luciferase gene | |
| siRNA concentration | 17 nM | |
| Cell or Organism used | HeLa cells | |
| Transfection method | Lipofectamine 2000 | |
| Duration after transfection | 24 Hours | |
| Article title | Crystal structure, stability and in vitro RNAi activity of oligoribonucleotides containing the ribo-difluorotoluyl nucleotide: insights into substrate requirements by the human RISC Ago2 enzyme |
|
| Reference | 17881374 | |