| Field | Sense | Antisense |
| siRNA chemical modification | Morpholinouridine | 0 |
| siRNA modification types | 1 | 0 |
| Overall number of modifications | 2 | 0 |
| Position of modifications | 20,21 | 0 |
| Modification on sugar or base or phosphate | Sugar | 0 |
| SMILES (Click to view structure & nomenclature) |
OCC1CN(CC(O1)N1C=CC(=O)NC1=O)OP(O)([O-])=O |
- |
| siRNA Sequence | CUUACGCUGAGUACUUCGAUU | UCGAAGUACUCAGCGUAAGTT |
| siRNA length base-pair | 21 | 21 |
| siRNA name in paper | 8 | 8 |
| Biological activity | 86 percent target mRNA inhibition | |
| Experiment used to check activity | Dual luciferase reporter assay | |
| Melting temperature (oC) | NA | |
| Target gene | Luciferase gene | |
| siRNA concentration | 25 nM | |
| Cell or Organism used | HeLa cells | |
| Transfection method | Lipofectamine 2000 | |
| Duration after transfection | 24 Hours | |
| Article title | RNA interference in mammalian cells by siRNAs modified with morpholino nucleoside analogues |
|
| Reference | 19233658 | |