Field | Sense | Antisense |
siRNA chemical modification | 0 | Pyrene modification |
siRNA modification types | 0 | 1 |
Overall number of modifications | 0 | 1 |
Position of modifications | 0 | 21 |
Modification on sugar or base or phosphate | 0 | Sugar |
SMILES (Click to view structure & nomenclature) |
- |
C1=CC2=C3C(C=CC4=CC=CC(C=C2)=C34)=C |
siRNA Sequence | UCGAAGUAUUCCGCGUACGTT | CGUACGCGGAAUACUUCGATT |
siRNA length base-pair | 21 | 21 |
siRNA name in paper | PY | PY |
Biological activity | 20 percent target mRNA inhibition | |
Experiment used to check activity | Dual luciferase reporter assay | |
Melting temperature (oC) | NA | |
Target gene | Luciferase gene | |
siRNA concentration | 0.32 nM | |
Cell or Organism used | SH-SY5Y cells | |
Transfection method | NA | |
Duration after transfection | 60 Hours | |
Article title | Modified siRNAs for the study of the PAZ domain |
|
Reference | 20485810 |