Field | Sense | Antisense |
siRNA chemical modification | 2,4-Difluorotoluene | 0 |
siRNA modification types | 1 | 0 |
Overall number of modifications | 1 | 0 |
Position of modifications | 9 | 0 |
Modification on sugar or base or phosphate | Base | 0 |
SMILES (Click to view structure & nomenclature) |
CC1=CC(CC2OC(CO)C(O)C2O)=C(F)C=C1F |
- |
siRNA Sequence | CUUACGCUGAGUACUUCGATT | TCGAAGUACUCAGCGUAAGTT |
siRNA length base-pair | 21 | 21 |
siRNA name in paper | G9 -> F | G9 -> F |
Biological activity | NA | |
Experiment used to check activity | Firefly luciferase assay and chemoluminescent assay | |
Melting temperature (oC) | 60.5 | |
Target gene | Luciferase gene | |
siRNA concentration | 0.002 to 8.0 nM | |
Cell or Organism used | HeLa cells | |
Transfection method | Lipofectamine 2000 | |
Duration after transfection | 24 Hours | |
Article title | Modulation of thermal stability can enhance the potency of siRNA |
|
Reference | 20610434 |