| Field | Sense | Antisense |
| siRNA chemical modification | 5-Nitroindole-2-Deoxyribonucleotide | 0 |
| siRNA modification types | 1 | 0 |
| Overall number of modifications | 1 | 0 |
| Position of modifications | 12 | 0 |
| Modification on sugar or base or phosphate | Base | 0 |
| SMILES (Click to view structure & nomenclature) |
OCC1OC(CC1O)N1C=CC2=CC(=CC=C12)[N+]([O-])=O |
- |
| siRNA Sequence | CUUACGCUGAGUACUUCGATT | TCGAAGUACUCAGCGUAAGTT |
| siRNA length base-pair | 21 | 21 |
| siRNA name in paper | U12 -> dN | U12 -> dN |
| Biological activity | NA | |
| Experiment used to check activity | Firefly luciferase assay and chemoluminescent assay | |
| Melting temperature (oC) | 65.4 | |
| Target gene | Luciferase gene | |
| siRNA concentration | 0.002 to 8.0 nM | |
| Cell or Organism used | HeLa cells | |
| Transfection method | Lipofectamine 2000 | |
| Duration after transfection | 24 Hours | |
| Article title | Modulation of thermal stability can enhance the potency of siRNA |
|
| Reference | 20610434 | |