| Field | Sense | Antisense |
| siRNA chemical modification | Phosphorothioate* 2,4-Difluorotoluene | 0 |
| siRNA modification types | 2 | 0 |
| Overall number of modifications | 2 | 0 |
| Position of modifications | 9 * 10 | 0 |
| Modification on sugar or base or phosphate | Phosphate; Base | 0 |
| SMILES (Click to view structure & nomenclature) |
OCC1OCC(O)C1OP(O)(S)=O CC1=CC(CC2OC(CO)C(O)C2O)=C(F)C=C1F |
- |
| siRNA Sequence | CUUACGCUGAAGUACUUCGAAA | UCGAAGUACUCAGCGUAAGUG |
| siRNA length base-pair | 22 | 21 |
| siRNA name in paper | G9 -> Gs; A10 -> F (siRNA 2) | G9 -> Gs; A10 -> F (siRNA 2) |
| Biological activity | IC-50 = 0.052 nM for target mRNA | |
| Experiment used to check activity | Firefly luciferase assay and chemoluminescent assay | |
| Melting temperature (oC) | NA | |
| Target gene | Luciferase gene | |
| siRNA concentration | 0.002 to 8.0 nM | |
| Cell or Organism used | HeLa cells | |
| Transfection method | Lipofectamine 2000 | |
| Duration after transfection | 24 Hours | |
| Article title | Modulation of thermal stability can enhance the potency of siRNA |
|
| Reference | 20610434 | |