| Field | Sense | Antisense |
| siRNA chemical modification | Phosphorothioate* Dimethoxy-Nitrophenyl Ethyl group | Phosphorothioate* Dimethoxy-Nitrophenyl Ethyl group |
| siRNA modification types | 2 | 2 |
| Overall number of modifications | 4 | 4 |
| Position of modifications | 2,27 * 1,27 | 2,27 * 1,27 |
| Modification on sugar or base or phosphate | Phosphate | Phosphate |
| SMILES (Click to view structure & nomenclature) |
OCC1OCC(O)C1OP(O)(S)=O COC1=C(OC)C=C(C(C)=C1)[N+]([O-])=O |
OCC1OCC(O)C1OP(O)(S)=O COC1=C(OC)C=C(C(C)=C1)[N+]([O-])=O |
| siRNA Sequence | AAGCUGACCCUGAAGUUCAUCUGCACC | GGUGCAGAUGAACUUCAGGGUCAGCUU |
| siRNA length base-pair | 27 | 27 |
| siRNA name in paper | PS2-DMNPE | PS2-DMNPE |
| Biological activity | 89 percent target mRNA inhibition | |
| Experiment used to check activity | GFP signal 10 minute UV exposure | |
| Melting temperature (oC) | NA | |
| Target gene | GFP gene | |
| siRNA concentration | 1.56 nM | |
| Cell or Organism used | HeLa cells | |
| Transfection method | Lipofectamine (Invitrogen) | |
| Duration after transfection | 42 Hours | |
| Article title | Enhanced light-activated RNA interference using phosphorothioate-based dsRNA precursors of siRNA |
|
| Reference | 21739319 | |