Field | Sense | Antisense |
siRNA chemical modification | Phosphorothioate* Dimethoxy-Nitrophenyl Ethyl group | Phosphorothioate* Dimethoxy-Nitrophenyl Ethyl group |
siRNA modification types | 2 | 2 |
Overall number of modifications | 8 | 8 |
Position of modifications | 2,3,4,25,26,27 * 1,27 | 2,3,4,25,26,27 * 1,27 |
Modification on sugar or base or phosphate | Phosphate | Phosphate |
SMILES (Click to view structure & nomenclature) |
OCC1OCC(O)C1OP(O)(S)=O COC1=C(OC)C=C(C(C)=C1)[N+]([O-])=O |
OCC1OCC(O)C1OP(O)(S)=O COC1=C(OC)C=C(C(C)=C1)[N+]([O-])=O |
siRNA Sequence | AAGCUGACCCUGAAGUUCAUCUGCACC | GGUGCAGAUGAACUUCAGGGUCAGCUU |
siRNA length base-pair | 27 | 27 |
siRNA name in paper | PS6-DMNPE | PS6-DMNPE |
Biological activity | 88 percent target mRNA inhibition | |
Experiment used to check activity | GFP signal 10 minute UV exposure | |
Melting temperature (oC) | NA | |
Target gene | GFP gene | |
siRNA concentration | 1.56 nM | |
Cell or Organism used | HeLa cells | |
Transfection method | Lipofectamine (Invitrogen) | |
Duration after transfection | 42 Hours | |
Article title | Enhanced light-activated RNA interference using phosphorothioate-based dsRNA precursors of siRNA |
|
Reference | 21739319 |