| Field | Sense | Antisense |
| siRNA chemical modification | 2-Fluoro | 5-Bromo-Uridine |
| siRNA modification types | 1 | 1 |
| Overall number of modifications | 10 | 5 |
| Position of modifications | 2,5,7,10,11,12,13,14,15,16 | 2,3,11,14,17 |
| Modification on sugar or base or phosphate | Sugar | Base |
| SMILES (Click to view structure & nomenclature) |
OCC1OCC(F)C1O |
OCC1OC(C(O)C1O)N1C=C(Br)C(=O)NC1= |
| siRNA Sequence | GCAGCACGACUUCUUCAAGTT | CUUGAAGAAGUCGUGCUGCTT |
| siRNA length base-pair | 21 | 21 |
| siRNA name in paper | ss-2-FU, FC/AS-U[5Br] | ss-2-FU, FC/AS-U[5Br] |
| Biological activity | 31 percent target mRNA inhibition | |
| Experiment used to check activity | Dual fluorescence assay | |
| Melting temperature (oC) | NA | |
| Target gene | EGFP gene | |
| siRNA concentration | 50 nM | |
| Cell or Organism used | HeLa cells | |
| Transfection method | Lipofectamine (Invitrogen) | |
| Duration after transfection | 4 -144 Hours | |
| Article title | siRNA function in RNAi: a chemical modification analysis |
|
| Reference | 12923253 | |