Field | Sense | Antisense |
siRNA chemical modification | 0 | N-3 Methyluridine |
siRNA modification types | 0 | 1 |
Overall number of modifications | 0 | 5 |
Position of modifications | 0 | 2,3,11,14,17 |
Modification on sugar or base or phosphate | 0 | Base |
SMILES (Click to view structure & nomenclature) |
- |
CN1C(=O)C=CN(C2OC(CO)C(O)C2O)C1=O |
siRNA Sequence | GCAGCACGACUUCUUCAAGTT | CUUGAAGAAGUCGUGCUGCTT |
siRNA length base-pair | 21 | 21 |
siRNA name in paper | ss/AS-3MU | ss/AS-3MU |
Biological activity | 0 percent target mRNA inhibition | |
Experiment used to check activity | Dual fluorescence assay | |
Melting temperature (oC) | NA | |
Target gene | EGFP gene | |
siRNA concentration | 50 nM | |
Cell or Organism used | HeLa cells | |
Transfection method | Lipofectamine (Invitrogen) | |
Duration after transfection | 4 -144 Hours | |
Article title | siRNA function in RNAi: a chemical modification analysis |
|
Reference | 12923253 |