| Field | Sense | Antisense |
| siRNA chemical modification | 0 | 4-Methylbenzimidazole |
| siRNA modification types | 0 | 1 |
| Overall number of modifications | 0 | 1 |
| Position of modifications | 0 | 8 |
| Modification on sugar or base or phosphate | 0 | Base |
| SMILES (Click to view structure & nomenclature) |
- |
CC1=CC=CC2=C1N=CN2C1OC(CO)C(O)C1O |
| siRNA Sequence | ACCUGACGUUGUACAAAUUTT | AAUUUGUACAACGUCAGGUTT |
| siRNA length base-pair | 21 | 21 |
| siRNA name in paper | 8Z | 8Z |
| Biological activity | 0 percent target mRNA inhibition | |
| Experiment used to check activity | Dual luciferase reporter assay | |
| Melting temperature (oC) | 59 | |
| Target gene | Luciferase gene | |
| siRNA concentration | 2.1 ng | |
| Cell or Organism used | HeLa cells | |
| Transfection method | Liposomes | |
| Duration after transfection | 22 Hours | |
| Article title | Steric effects in RNA interference: probing the influence of nucleobase size and shape |
|
| Reference | 18624291 | |