Field | Sense | Antisense |
siRNA chemical modification | 0 | 4-Methylbenzimidazole |
siRNA modification types | 0 | 1 |
Overall number of modifications | 0 | 1 |
Position of modifications | 0 | 16 |
Modification on sugar or base or phosphate | 0 | Base |
SMILES (Click to view structure & nomenclature) |
- |
CC1=CC=CC2=C1N=CN2C1OC(CO)C(O)C1O |
siRNA Sequence | ACCUGACGUUGUACAAAUUTT | AAUUUGUACAACGUCAGGUTT |
siRNA length base-pair | 21 | 21 |
siRNA name in paper | 16Z | 16Z |
Biological activity | 0 percent target mRNA inhibition | |
Experiment used to check activity | Dual luciferase reporter assay | |
Melting temperature (oC) | 63 | |
Target gene | Luciferase gene | |
siRNA concentration | 2.1 ng | |
Cell or Organism used | HeLa cells | |
Transfection method | Liposomes | |
Duration after transfection | 22 Hours | |
Article title | Steric effects in RNA interference: probing the influence of nucleobase size and shape |
|
Reference | 18624291 |