| Field | Sense | Antisense |
| siRNA chemical modification | 2,4-Difluorotoluene | 0 |
| siRNA modification types | 1 | 0 |
| Overall number of modifications | 1 | 0 |
| Position of modifications | 19 | 0 |
| Modification on sugar or base or phosphate | Base | 0 |
| SMILES (Click to view structure & nomenclature) |
CC1=CC(CC2OC(CO)C(O)C2O)=C(F)C=C1F |
- |
| siRNA Sequence | ACCUGACGUAGUUCAAAUUTT | AAAAUUUGUACUACGUCAGGU |
| siRNA length base-pair | 21 | 21 |
| siRNA name in paper | ss-19F | ss-19F |
| Biological activity | 98 percent target mRNA inhibition | |
| Experiment used to check activity | Dual luciferase reporter assay | |
| Melting temperature (oC) | NA | |
| Target gene | Luciferase gene | |
| siRNA concentration | 2.1 ng | |
| Cell or Organism used | HeLa cells | |
| Transfection method | Liposomes | |
| Duration after transfection | 22 Hours | |
| Article title | Steric effects in RNA interference: probing the influence of nucleobase size and shape |
|
| Reference | 18624291 | |