| Field | Sense | Antisense |
| siRNA chemical modification | 0 | 2-Deoxy-2-fluorouridine |
| siRNA modification types | 0 | 1 |
| Overall number of modifications | 0 | 2 |
| Position of modifications | 0 | 3,20 |
| Modification on sugar or base or phosphate | 0 | Sugar |
| SMILES (Click to view structure & nomenclature) |
- |
OCC1OC(C(F)C1O)N1C=CC(=O)NC1=O |
| siRNA Sequence | AGACGAGCUGAGCGAGAAGTT | TTUCUGCUCGACUCGCUCUUC |
| siRNA length base-pair | 21 | 21 |
| siRNA name in paper | F3 | F3 |
| Biological activity | NA | |
| Experiment used to check activity | NA | |
| Melting temperature (oC) | 80 | |
| Target gene | Human Caveolin-1 gene | |
| siRNA concentration | 200 nM | |
| Cell or Organism used | HeLa cells | |
| Transfection method | Oligofectamine (Invitrogen) | |
| Duration after transfection | 10-14 Hours | |
| Article title | RNA interference in mammalian cells by chemically-modified RNA |
|
| Reference | 12834349 | |