| Field | Sense | Antisense |
| siRNA chemical modification | 2-Deoxythymidine | L-isonucleoside adenosine* 2-Deoxythymidine |
| siRNA modification types | 1 | 2 |
| Overall number of modifications | 2 | 3 |
| Position of modifications | 20,21 | 19 * 20,21 |
| Modification on sugar or base or phosphate | Sugar | Sugar ; Sugar |
| SMILES (Click to view structure & nomenclature) |
CC1=CN(C2CC(O)C(CO)O2)C(=O)NC1=O |
NC1=C2N=CN(C3COC(CO)C3OP(O)([O-])=O)C2=NC=N1 CC1=CN(C2CC(O)C(CO)O2)C(=O)NC1=O |
| siRNA Sequence | UCGGGAAAUUUCUCUAUUATT | UAAUAGAGAAAUUUCCCGATT |
| siRNA length base-pair | 21 | 21 |
| siRNA name in paper | A | BII |
| Biological activity | 90 percent target mRNA inhibition | |
| Experiment used to check activity | Dual luciferase assay | |
| Melting temperature (oC) | NA | |
| Target gene | Cdc-gene strand B | |
| siRNA concentration | 13 nM | |
| Cell or Organism used | HEK293 cells | |
| Transfection method | Lipofectamine 2000 | |
| Duration after transfection | 24 Hours | |
| Article title | Synthesis and properties of novel L-isonucleoside modified oligonucleotides and siRNAs |
|
| Reference | 22895883 | |