| Field | Sense | Antisense |
| siRNA chemical modification | Serinol nucleic acid | Phosphate |
| siRNA modification types | 1 | 1 |
| Overall number of modifications | 4 | 1 |
| Position of modifications | 1,2,22,23 | 1 |
| Modification on sugar or base or phosphate | Sugar | Sugar |
| SMILES (Click to view structure & nomenclature) |
CC(=O)NC(CO)COP(O)(O)=O |
OCC1OCC(O)C1OP(O)([O-])=O |
| siRNA Sequence | AACCUUACCCACCUCAUGUAUCU | AUACAUGAGGUGGGUAAGGUU |
| siRNA length base-pair | 23 | 21 |
| siRNA name in paper | S53 | 21A-5P |
| Biological activity | 80 percent target mRNA inhibition | |
| Experiment used to check activity | Dual luciferase assay | |
| Melting temperature (oC) | NA | |
| Target gene | Firefly luciferase expression | |
| siRNA concentration | 17 nM | |
| Cell or Organism used | 293FT cells | |
| Transfection method | Lipofectamine 2000 | |
| Duration after transfection | 48 Hours | |
| Article title | Enhancement of stability and activity of siRNA by terminal substitution with serinol nucleic acid (SNA) |
|
| Reference | 25233814 | |