| Field | Sense | Antisense |
| siRNA chemical modification | Triazole-linked nucleic acid | 2-Deoxythymidine |
| siRNA modification types | 1 | 1 |
| Overall number of modifications | 1 | 2 |
| Position of modifications | 20 | 20,21 |
| Modification on sugar or base or phosphate | Phosphate | Sugar |
| SMILES (Click to view structure & nomenclature) |
CCN(CCN1C=C(CN(CC)C(C)=O)N=N1)C(C)=O |
CC1=CN(C2CC(O)C(CO)O2)C(=O)NC1=O |
| siRNA Sequence | CUUACGCUGAGUACUUCGAUU | UCGAAGUACUCAGCGUAAGTT |
| siRNA length base-pair | 21 | 21 |
| siRNA name in paper | aL11 | aL11 |
| Biological activity | 93 percent target mRNA inhibition | |
| Experiment used to check activity | Dual luciferase reporter assay | |
| Melting temperature (oC) | NA | |
| Target gene | Firefly luciferase gene | |
| siRNA concentration | 0.008 nM | |
| Cell or Organism used | HeLa cells | |
| Transfection method | Lipofectamine 2000 | |
| Duration after transfection | 48 Hours | |
| Article title | Conjugation and Evaluation of Small Hydrophobic Molecules to Triazole-Linked siRNAs |
|
| Reference | 25699137 | |