| Field | Sense | Antisense |
| siRNA chemical modification | [3-(hydroxymethyl)-5-naphthalen-1-ylphenyl]methanol | [3-(hydroxymethyl)-5-naphthalen-1-ylphenyl]methanol |
| siRNA modification types | 1 | 1 |
| Overall number of modifications | 2 | 2 |
| Position of modifications | 20,21 | 20,21 |
| Modification on sugar or base or phosphate | Base | Base |
| SMILES (Click to view structure & nomenclature) |
OCC1=CC(=CC(CO)=C1)C1=CC=CC2=CC=CC=C12 |
OCC1=CC(=CC(CO)=C1)C1=CC=CC2=CC=CC=C12 |
| siRNA Sequence | GGCCUUUCACUACUCCUACTT | GUAGGAGUAGUGAAAGGCCTT |
| siRNA length base-pair | 21 | 21 |
| siRNA name in paper | siRNA20 | siRNA20 |
| Biological activity | 30 percent target mRNA inhibition | |
| Experiment used to check activity | Dual luciferase reporter assay | |
| Melting temperature (oC) | 80.7 | |
| Target gene | Renilla luciferase | |
| siRNA concentration | 1 nM | |
| Cell or Organism used | HeLa cells | |
| Transfection method | Lipofectamine RNAiMAX (Invitrogen) and Opti-MEM (GIBCO-BRL) | |
| Duration after transfection | 24 Hours | |
| Article title | Incorporation of biaryl units into the 5' and 3' ends of sense and antisense strands of siRNA duplexes improves strand selectivity and nuclease resistance |
|
| Reference | 21141919 | |