| Field | Sense | Antisense |
| siRNA chemical modification | Fluorescein* [1,1-Biphenyl]-3,5-dimethanol | [1,1-Biphenyl]-3,5-dimethanol |
| siRNA modification types | 2 | 1 |
| Overall number of modifications | 3 | 2 |
| Position of modifications | 1 * 21,22 | 21,22 |
| Modification on sugar or base or phosphate | Base | Base |
| SMILES (Click to view structure & nomenclature) |
OC1=CC2=C(C=C1)C1(OC(=O)C3=CC=CC=C13)C1=C(O2)C=C(O)C=C1 OCC1=CC(=CC(CO)=C1)C1=CC=CC=C1 |
OCC1=CC(=CC(CO)=C1)C1=CC=CC=C1 |
| siRNA Sequence | GGCCUUUCACUACUCCUACTT | GUAGGAGUAGUGAAAGGCCTT |
| siRNA length base-pair | 21 | 21 |
| siRNA name in paper | siRNA24 | siRNA24 |
| Biological activity | NA | |
| Experiment used to check activity | Dual luciferase reporter assay | |
| Melting temperature (oC) | NA | |
| Target gene | Renilla luciferase | |
| siRNA concentration | 1 nM | |
| Cell or Organism used | HeLa cells | |
| Transfection method | Lipofectamine RNAiMAX (Invitrogen) and Opti-MEM (GIBCO-BRL) | |
| Duration after transfection | 24 Hours | |
| Article title | Incorporation of biaryl units into the 5' and 3' ends of sense and antisense strands of siRNA duplexes improves strand selectivity and nuclease resistance |
|
| Reference | 21141919 | |