Field | Sense | Antisense |
siRNA chemical modification | Triazole-linked nucleic acid | 2-Deoxythymidine |
siRNA modification types | 1 | 1 |
Overall number of modifications | 3 | 2 |
Position of modifications | 2,15,20 | 20,21 |
Modification on sugar or base or phosphate | Backbone | Sugar |
SMILES (Click to view structure & nomenclature) |
CCN(CCN1C=C(CN(CC)C(C)=O)N=N1)C(C)=O |
CC1=CN(C2CC(O)C(CO)O2)C(=O)NC1=O |
siRNA Sequence | CUUACGCUGAGUACUUCGATT | UCGAAGUACUCAGCGUAAGTT |
siRNA length base-pair | 21 | 21 |
siRNA name in paper | 21 | 21 |
Biological activity | 77 percent target mRNA inhibition | |
Experiment used to check activity | Luciferase gene reporter assay | |
Melting temperature (oC) | 57.3 | |
Target gene | Firefly luciferase | |
siRNA concentration | 0.8 nM | |
Cell or Organism used | HeLa cells | |
Transfection method | NA | |
Duration after transfection | 24 Hours | |
Article title | Efficient synthesis and cell-based silencing activity of siRNAS that contain triazole backbone linkages |
|
Reference | 22260772 |