| Field | Sense | Antisense |
| siRNA chemical modification | Triazole-linked nucleic acid | 2-Deoxythymidine |
| siRNA modification types | 1 | 1 |
| Overall number of modifications | 1 | 2 |
| Position of modifications | 20 | 20,21 |
| Modification on sugar or base or phosphate | Sugar; Backbone | Sugar |
| SMILES (Click to view structure & nomenclature) |
CCN(CCN1C=C(CN(CC)C(C)=O)N=N1)C(C)=O |
CC1=CN(C2CC(O)C(CO)O2)C(=O)NC1=O |
| siRNA Sequence | GGUCAUCCAUGACAACUUUTT | AAAGUUGUCAUGGAUGACCTT |
| siRNA length base-pair | 21 | 21 |
| siRNA name in paper | 26 | 26 |
| Biological activity | 89 percent target mRNA inhibition | |
| Experiment used to check activity | Real-time PCR | |
| Melting temperature (oC) | NA | |
| Target gene | Glyceraldehyde-3-phosphate dehydrogenase (GAPDH) gene | |
| siRNA concentration | 20 nM | |
| Cell or Organism used | HeLa cells | |
| Transfection method | NA | |
| Duration after transfection | 24 Hours | |
| Article title | Efficient synthesis and cell-based silencing activity of siRNAS that contain triazole backbone linkages |
|
| Reference | 22260772 | |