| Field | Sense | Antisense |
| siRNA chemical modification | Thymidine | Thymidine |
| siRNA modification types | 1 | 1 |
| Overall number of modifications | 2 | 2 |
| Position of modifications | 20,21 | 20,21 |
| Modification on sugar or base or phosphate | Sugar | Sugar |
| SMILES (Click to view structure & nomenclature) |
CC1=CN(C2CC(O)C(CO)O2)C(=O)NC1=O |
CC1=CN(C2CC(O)C(CO)O2)C(=O)NC1=O |
| siRNA Sequence | GGACAUUCAGAACAAGAAATT | UUUCUUGUUCUGAAUGUCCTT |
| siRNA length base-pair | 21 | 21 |
| siRNA name in paper | siRNA | siRNA |
| Biological activity | 80 percent target mRNA inhibition | |
| Experiment used to check activity | qRT PCR | |
| Melting temperature (oC) | NA | |
| Target gene | ApoB gene | |
| siRNA concentration | 5nM | |
| Cell or Organism used | HepG2 cells | |
| Transfection method | RNAiMAX | |
| Duration after transfection | 24 Hoursrs | |
| Article title | Improved specificity of gene silencing by siRNAs containing unlocked nucleobase analogs |
|
| Reference | 21047800 | |