| Field | Sense | Antisense |
| siRNA chemical modification | 2,4-bridged nucleic acid* DeoxyThymidine | DeoxyThymidine |
| siRNA modification types | 2 | 1 |
| Overall number of modifications | 7 | 2 |
| Position of modifications | 1,2,5,15,18 * 23,24 | 23,24 |
| Modification on sugar or base or phosphate | Sugar | Sugar |
| SMILES (Click to view structure & nomenclature) |
OCC12COC(CO1)C2O CC1=CN(C2CC(O)C(CO)O2)C(=O)NC1=O |
CC1=CN(C2CC(O)C(CO)O2)C(=O)NC1=O |
| siRNA Sequence | GTCATCACACUGAATACCAAUUTT | AAUUGGUAUUCAGUGUGAUGACTT |
| siRNA length base-pair | 24 | 24 |
| siRNA name in paper | siLNA-2 | siLNA-2 |
| Biological activity | 70 percent target mRNA inhibition | |
| Experiment used to check activity | Quantitative PCR analysis | |
| Melting temperature (oC) | 83.3 | |
| Target gene | apoB gene | |
| siRNA concentration | 10nM/L | |
| Cell or Organism used | NMuLi cells | |
| Transfection method | Lipofectamine RNAiMAX | |
| Duration after transfection | NA | |
| Article title | Development of a 2',4'-BNA/LNA-based siRNA for Dyslipidemia and Assessment of the Effects of Its Chemical Modifications In Vivo |
|
| Reference | 23344237 | |