Details of SAPdb entry with Sequence FF |
| Primary information | |
|---|---|
| SAPdb ID | 1001, |
| PMID | 18070345 |
| Peptide Name | Fmoc-Phe-Phe |
| Peptide sequence | FF |
| N-Terminal Modification | Fmoc |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Confocal Microscopy |
| Solvent | Dispersion medium= PBS 10x, DMSO (gelling agent)= 100mg/ml |
| Method | Lyophilized Fmoc-Phe-Phe dipeptide was weighed and dissolved in DMSO. This was applied to the desired dispersion medium. |
| Conc | 0.005% |
| Temperature | pH 7 |
| Temperature | 37 °C |
| Year | 2007 |
| Self assembly | No |
| Type of Self assembly | Unstable hydrogel assembly |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Unstable | |
| Hydrogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1002, |
| PMID | 18070345 |
| Peptide Name | Fmoc-Phe-Phe |
| Peptide sequence | FF |
| N-Terminal Modification | Fmoc |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Confocal Microscopy |
| Solvent | Dispersion medium= PBS 1x, DMSO (gelling agent)= 100mg/ml |
| Method | Lyophilized Fmoc-Phe-Phe dipeptide was weighed and dissolved in DMSO. This was applied to the desired dispersion medium. |
| Conc | 0.005% |
| Temperature | pH 7 |
| Temperature | 37 °C |
| Year | 2007 |
| Self assembly | No |
| Type of Self assembly | Unstable hydrogel assembly |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Unstable | |
| Hydrogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1003, |
| PMID | 18070345 |
| Peptide Name | Fmoc-Phe-Phe |
| Peptide sequence | FF |
| N-Terminal Modification | Fmoc |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Confocal Microscopy |
| Solvent | Dispersion medium= PBS 1x, DMSO (gelling agent)= 100mg/ml |
| Method | Lyophilized Fmoc-Phe-Phe dipeptide was weighed and dissolved in DMSO. This was applied to the desired dispersion medium. |
| Conc | 0.01% |
| Temperature | pH 7 |
| Temperature | 37 °C |
| Year | 2007 |
| Self assembly | No |
| Type of Self assembly | Partial hydrogel assembly |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Partial | |
| Hydrogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1004, |
| PMID | 18070345 |
| Peptide Name | Fmoc-Phe-Phe |
| Peptide sequence | FF |
| N-Terminal Modification | Fmoc |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Confocal Microscopy |
| Solvent | Dispersion medium= PBS 1x, DMSO (gelling agent)= 25mg/ml |
| Method | Lyophilized Fmoc-Phe-Phe dipeptide was weighed and dissolved in DMSO. This was applied to the desired dispersion medium. |
| Conc | 0.005% |
| Temperature | pH 7 |
| Temperature | 37 °C |
| Year | 2007 |
| Self assembly | No |
| Type of Self assembly | Soft hydrogel assembly |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Soft gel | |
| Hydrogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1005, |
| PMID | 18070345 |
| Peptide Name | Fmoc-Phe-Phe |
| Peptide sequence | FF |
| N-Terminal Modification | Fmoc |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Confocal Microscopy |
| Solvent | Dispersion medium= PBS 1x, DMSO (gelling agent)= 25mg/ml |
| Method | Lyophilized Fmoc-Phe-Phe dipeptide was weighed and dissolved in DMSO. This was applied to the desired dispersion medium. |
| Conc | 0.01% |
| Temperature | pH 7 |
| Temperature | 37 °C |
| Year | 2007 |
| Self assembly | Yes |
| Type of Self assembly | Firm hydrogel assembly |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Firm gel | |
| Hydrogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1006, |
| PMID | 18070345 |
| Peptide Name | Fmoc-Phe-Phe |
| Peptide sequence | FF |
| N-Terminal Modification | Fmoc |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Confocal Microscopy |
| Solvent | Dispersion medium= MEM, DMSO (gelling agent)= 25mg/ml |
| Method | Lyophilized Fmoc-Phe-Phe dipeptide was weighed and dissolved in DMSO. This was applied to the desired dispersion medium. |
| Conc | 0.005% |
| Temperature | pH 7 |
| Temperature | 37 °C |
| Year | 2007 |
| Self assembly | No |
| Type of Self assembly | Unstable hydrogel assembly |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Unstable | |
| Hydrogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1013, |
| PMID | 12714741 |
| Peptide Name | NH2-L-Phe-L-Phe-COOH |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Aqueous dispersion |
| Method | NH2-L-Phe-L-Phe-COOH dipeptide solublized at very high concentrations ( >=100 mg/ml) by dissolving the lyophilized peptide in 1,1,1,3,3,3 hexafluoro-2-propanol. The peptide appeared to be highly soluble in the organic solvent, a rapid assembly into ordered semicrystalline structures was observed visually within seconds after dilution into the aqueous solution at a final µM concentration range. |
| Conc | >=100 mg/ml stock soln |
| Temperature | 80°C |
| Incubation Time | Within few minutes |
| Year | 2003 |
| Self assembly | Yes |
| Type of Self assembly | Nanotube |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| After 1 hour of incubation of the Phe-Phe peptide with proteinase K (0.02 mg/ml), no tubular structures were observed by electron microscopy examination (as compared with hundreds of tubular structures observed before the proteolysis). | |
| Nanotube | |
| 150 | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1014, |
| PMID | 12714741 |
| Peptide Name | NH2-D-Phe-D-Phe-COOH |
| Peptide sequence | ff |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Aqueous dispersion |
| Method | NH2-D-Phe-D-Phe-COOH dipeptide solublized at very high concentrations ( >=100 mg/ml) by dissolving the lyophilized peptide in 1,1,1,3,3,3 hexafluoro-2-propanol. The peptide appeared to be highly soluble in the organic solvent, a rapid assembly into ordered semicrystalline structures was observed visually within seconds after dilution into the aqueous solution at a final µM concentration range. |
| Conc | >=100 mg/ml stock soln |
| Temperature | 80°C |
| Incubation Time | Within few minutes |
| Year | 2003 |
| Self assembly | Yes |
| Type of Self assembly | Nanotube |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| No notable variation could be observed before and after the incubation of the D-Phe-D-Phe peptide with the enzyme proteinase K (0.02 mg/ml). | |
| Nanotube | |
| 150 | |
| ff | |
| N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1015, |
| PMID | 16430299 |
| Peptide Name | Diphenylalanine peptide |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | SEM (Scanning Electron Microscopy), TEM (Transmission Electron Microscopy), CD (Circular Dichroism spectroscopy) |
| Solvent | Aqueous dispersion |
| Method | Lyophilized form of the peptides dissolved in 1,1,1,3,3,3-hexafluoro-2-propanol at a concentration of 100 mg/mL. Peptide stock solution was diluted in double distilled (dd) H2O to a final concentration of 2 mg/mL incubated in a water bath at 80 °C for 1 h. |
| Conc | 2 mg/ml |
| Temperature | Stable upto 90°C |
| Incubation Time | Within few minutes |
| Year | 2006 |
| Self assembly | Yes |
| Type of Self assembly | Nanotube |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| In addition to thermal stability, the peptide nanotubes were chemically stable in organic solvents | |
| Nanotube | |
| NA | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1019, |
| PMID | 16719470 |
| Peptide Name | Diphenylalanine peptide |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | AFM (Atomic Force Microscopy) |
| Solvent | Aqueous dispersion |
| Method | Fresh stock solutions were prepared by dissolving the lyophilized peptides in 1,1,1,3,3,3-hexafluoro-2-propanol (Sigma Aldrich) at a concentration of 100 mg/mL. Peptide stock solution was diluted in double distilled (dd) H2O to a final concentration of 2 mg/mL. Samples were diluted in Elgar water to a final concentration of 0.2 or 1 mg/mL prior to dropping a 10 íL aliquot onto freshly cleaved mica and were subsequently dried in a vacuum generator. |
| Conc | 1mg/ml |
| Temperature | Stable upto 100°C |
| Year | 2006 |
| Self assembly | Yes |
| Type of Self assembly | Nanotube |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| The nanotubes are stable at temperatures up to 100°C, but on heating to higher temperatures begin to lose their structural integrity with an apparent collapse in tubular structure. | |
| Nanotube | |
| 525 | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1020, |
| PMID | 17328086 |
| Peptide Name | Cationic dipeptide nanotubes (CDPNTs) (H-Phe-Phe-NH2·HCl) |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | HCl |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | AFM (Atomic Force Microscopy), TEM (Transmission Electron Microscopy) |
| Solvent | Aqueous dispersion |
| Method | The CDPNTs were selfassembled at physiological pH values |
| Conc | 10 mg/ml |
| Temperature | pH 7.2 |
| Temperature | Room temperature |
| Year | 2007 |
| Self assembly | Yes |
| Type of Self assembly | Nanotube |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Cationic dipeptides (H-Phe-Phe-NH2·HCl) self-assemble into nanotubes at physiological pH values and these cationic dipeptide nanotubes (CDPNTs) can also rearrange to form vesicles upon dilution. | |
| Nanotube | |
| 190 | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1021, |
| PMID | 17328086 |
| Peptide Name | Cationic dipeptide nanotubes (CDPNTs) (H-Phe-Phe-NH2·HCl) |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | HCl |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | AFM (Atomic Force Microscopy), TEM (Transmission Electron Microscopy) |
| Solvent | Aqueous dispersion |
| Method | The CDPNTs were selfassembled at physiological pH values |
| Conc | 1 mg/ml |
| Temperature | pH 7.2 |
| Temperature | Room temperature |
| Year | 2007 |
| Self assembly | Yes |
| Type of Self assembly | Vesicles |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Cationic dipeptides (H-Phe-Phe-NH2·HCl) self-assemble into nanotubes at physiological pH values and these cationic dipeptide nanotubes (CDPNTs) can also rearrange to form vesicles upon dilution. | |
| Nanovesicle | |
| 100 | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1022, |
| PMID | 17328086 |
| Peptide Name | Zwitterionic dipeptide diphenylalanine (l-Phe-l-Phe) |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | CD (Circular Dichroism spectroscopy) |
| Solvent | Aqueous dispersion |
| Method | Dipeptide could self-assemble into nanotubes at a concentration of 10 mg/mL |
| Conc | 10 mg/ml |
| Temperature | pH 7.2 |
| Temperature | Room temperature |
| Year | 2007 |
| Self assembly | Yes |
| Type of Self assembly | Nanotube |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Nanotube | |
| NA | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1023, |
| PMID | 18035858 |
| Peptide Name | Diphenylalanine (H-Phe-Phe-OH) |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Aqueous dispersion |
| Method | Lyophilized form of the peptides dissolved in 1,1,1,3,3,3-HFP at a concentration of 50 or 100 mg/ml. |
| Conc | 10 mg/ml |
| Year | 2007 |
| Self assembly | Yes |
| Type of Self assembly | Nanotube |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Nanotube | |
| NA | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1024, |
| PMID | 18035858 |
| Peptide Name | Boc-Phe-Phe-OH |
| Peptide sequence | FF |
| N-Terminal Modification | Boc |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Aqueous dispersion |
| Method | Lyophilized form of the peptides dissolved in 1,1,1,3,3,3-HFP at a concentration of 50 or 100 mg/ml. For the preparation of nanospheres, a peptide stock solution was diluted in ethanol to a concentration of 10 mg/ml then immediately diluted in ddH2O to a final concentration of 5 mg/ml. |
| Conc | 5 mg/ml |
| Year | 2007 |
| Self assembly | Yes |
| Type of Self assembly | Nanosphere |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Remarkable chemical and thermal stability and extraordinary mechanical strength. The averaged point stiffness of the nanotubes is 160 N/m, and they have a correspondingly high Young’s modulus of ∼19 Gpa. | |
| Nanosphere | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1025, |
| PMID | 18035858 |
| Peptide Name | Fmoc-Phe-Phe-OH |
| Peptide sequence | FF |
| N-Terminal Modification | Fmoc |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Aqueous dispersion |
| Method | Lyophilized form of the peptides dissolved in 1,1,1,3,3,3-HFP at a concentration of 50 or 100 mg/ml. |
| Conc | 5 mg/ml |
| Year | 2007 |
| Self assembly | Yes |
| Type of Self assembly | Nanotube |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Nanotube | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1026, |
| PMID | 18035858 |
| Peptide Name | Boc-Phe-Phe-OH |
| Peptide sequence | FF |
| N-Terminal Modification | Boc |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Aqueous dispersion |
| Method | Lyophilized form of the peptides dissolved in 1,1,1,3,3,3-HFP at a concentration of 50 or 100 mg/ml.For the preparation of nanotubes the 100 mg/ml peptide stock solutions in HFP was diluted into a final concentration of 2 mg/ml in ddH2O. |
| Conc | 2 mg/ml |
| Year | 2007 |
| Self assembly | Yes |
| Type of Self assembly | Nanotube |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Nanotube | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1194, |
| PMID | 26295906 |
| Peptide Name | Fmoc-FF |
| Peptide sequence | FF |
| N-Terminal Modification | Fmoc(fluorenylmethoxycarbonyl) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | NMR diffusion - ordered spectroscopy (DOSY) |
| Solvent | Water+DMSO |
| Method | Peptide dissolved in deuterized water and DMSO solution at concentrations xH2O = 0.25–0.40. keep for sufficient time to ensure become gel. |
| Incubation Time | > 0.5 hours |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Solid Fibres |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanofibers | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1195, |
| PMID | 26287262 |
| Peptide Name | Boronic acid FF |
| Peptide sequence | FF |
| N-Terminal Modification | Carboxy-BA (Boronic acid) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy), AFM (Atomic Force Microscopy) |
| Solvent | Water |
| Method | 0.5-2 mg peptide was added to deionized water at 2 mg/mL. Concentrated NH4OH was then added in 0.5 μL aliquots to raise the pH to 10, yielding a homogenous solution. The pH was then lowered by conc. HCl or acetetic acid. When acidification was effected by diffusion of acetic acid vapor, a single, fibrous mass precipitated after several days upon reaching pH ≤ 5. |
| Conc | 2mg/ml |
| Temperature | < or = 5 |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel ( consists of Nanoribbon) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| 10 | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1196, |
| PMID | 26287262 |
| Peptide Name | Boronic acid FF |
| Peptide sequence | FF |
| N-Terminal Modification | Carboxy-BA (Boronic acid) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy), AFM (Atomic Force Microscopy) |
| Solvent | Water + 3M NaCl |
| Method | 0.5-2 mg peptide was first dissolved in pH 7 phosphate buffer at 2 10 mg/mL. NaCl was then added in an amount corresponding to 1.5-3 M concentration and quickly vortexed to dissolve Shortly thereafter, a hazy suspension or a highly opaque, self-supporting hydrogel is formed. |
| Conc | 2mg/ml |
| Temperature | > 5 or 7 |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel (consists of intertwined Fibril Network) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| 10 | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1197, |
| PMID | 26018930 |
| Peptide Name | Ferrocene-FF |
| Peptide sequence | FF |
| N-Terminal Modification | Ferrocene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | TEM (Transmission Electron Microscopy), SEM (Scanning Electron Microscopy) |
| Solvent | 10% HFIP (1,1,1,3,3,3-hexafluoro-2-propanol) and 90% H2O (v/ v) |
| Method | Peptide powder was dissolved in 1,1,1,3,3,3-hexafluoro-2-propanol (HFIP) at a concentration of 4 mM. To yield a mixture of 10% HFIP and 90% H2O (v/ v) with 4 mM peptide conc. The turbid yellow suspension was incubated at 37 °C for 2 h without disturbance to form self assembled structure. |
| Conc | 4mM |
| Temperature | < 5 |
| Temperature | 20°C |
| Incubation Time | 2 hours |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Rectangular Nanotube |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanotube | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1198, |
| PMID | 26018930 |
| Peptide Name | Ferrocene-FF |
| Peptide sequence | FF |
| N-Terminal Modification | Ferrocene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | TEM (Transmission Electron Microscopy), SEM (Scanning Electron Microscopy) |
| Solvent | 10% HFIP (1,1,1,3,3,3-hexafluoro-2-propanol) and 90% H2O (v/ v) |
| Method | Peptide powder was dissolved in 1,1,1,3,3,3-hexafluoro-2-propanol (HFIP) at a concentration of 20 mM. The Fc-FF HFIP solution (100 μL) was then injected into a 20 mM, pH 5.6 piperazine buffer solution (900 μL) to yield a mixture of 10% HFIP and 90% H2O (v/ v) with 4 mM. The turbid yellow suspension was incubated at 37 °C for 2 h without disturbance to form self assembled structure. |
| Conc | 20mM |
| Temperature | 5.6 |
| Temperature | 37°C |
| Incubation Time | 2 hours |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Nanofiber |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanofibers | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1199, |
| PMID | 26018930 |
| Peptide Name | Ferrocene-FF |
| Peptide sequence | FF |
| N-Terminal Modification | Ferrocene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | TEM (Transmission Electron Microscopy), SEM (Scanning Electron Microscopy) |
| Solvent | 10% HFIP (1,1,1,3,3,3-hexafluoro-2-propanol) and 90% Water (v/ v) + (R)-(-)-2-methylpiperazine |
| Method | Peptide powder was dissolved in 1,1,1,3,3,3-hexafluoro-2-propanol (HFIP) at a concentration of 20 mM. The Fc-FF HFIP solution (100 μL) was then injected into a 20 mM, pH 5.6 piperazine buffer solution (900 μL) to yield a mixture of 10% HFIP and 90% H2O (v/ v) with 4 mM. The turbid yellow suspension was incubated at 37 °C for 2 h without disturbance to form self assembled structure. |
| Conc | 4mM |
| Temperature | 5.6 |
| Temperature | 37°C |
| Incubation Time | 2 hours |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Nanohelicals (right handed) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanohelicals | |
| 100000 | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1200, |
| PMID | 26018930 |
| Peptide Name | Ferrocene-FF |
| Peptide sequence | FF |
| N-Terminal Modification | Ferrocene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | TEM (Transmission Electron Microscopy), SEM (Scanning Electron Microscopy) |
| Solvent | 10% HFIP (1,1,1,3,3,3-hexafluoro-2-propanol) and 90% Water (v/ v) + (S)-(+)-2-methylpiperazine |
| Method | Peptide powder was dissolved in 1,1,1,3,3,3-hexafluoro-2-propanol (HFIP) at a concentration of 20 mM. The Fc-FF HFIP solution (100 μL) was then injected into a 20 mM, pH 5.6 piperazine buffer solution (900 μL) to yield a mixture of 10% HFIP and 90% H2O (v/ v) with 4 mM. This suspension was incubated at 37 °C for 2 h without disturbance to form self assembled structure. |
| Conc | 4mM |
| Temperature | 5.6 |
| Temperature | 37°C |
| Incubation Time | 2 hours |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Nanofibers (right handed) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanohelicals | |
| 100000 | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1201, |
| PMID | 26018930 |
| Peptide Name | Ferrocene-FF |
| Peptide sequence | FF |
| N-Terminal Modification | Ferrocene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | TEM (Transmission Electron Microscopy), SEM (Scanning Electron Microscopy) |
| Solvent | 10% HFIP + 90% piperazine buffer solution (20 mM, pH 5.6) |
| Method | Peptide powder was dissolved in 1,1,1,3,3,3-hexafluoro-2-propanol (HFIP) at a concentration of 20 mM. The Fc-FF HFIP solution (100 μL) was then injected into a 20 mM, pH 5.6 piperazine buffer solution (900 μL) to yield a mixture of 10% HFIP and 90% H2O (v/ v) with 4 mM. This suspension was incubated at 37 °C for 2 h without disturbance to form self assembled structure. |
| Conc | 4mM |
| Temperature | 5.3 - 5.6 |
| Temperature | 37°C |
| Incubation Time | 2 hours |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Highly twisted chiral Nanostructures (big twists) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanohelicals | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1202, |
| PMID | 26018930 |
| Peptide Name | Ferrocene-FF |
| Peptide sequence | FF |
| N-Terminal Modification | Ferrocene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | TEM (Transmission Electron Microscopy), SEM (Scanning Electron Microscopy) |
| Solvent | 10% HFIP + 90% piperazine buffer solution (20 mM, pH 5.6) |
| Method | Peptide powder was dissolved in 1,1,1,3,3,3-hexafluoro-2-propanol (HFIP) at a concentration of 20 mM. The Fc-FF HFIP solution (100 μL) was then injected into a 20 mM, pH 6 piperazine buffer solution (900 μL) to yield a mixture of 10% HFIP and 90% H2O (v/ v) with 4 mM. This suspension was incubated at 37 °C for 2 h without disturbance to form self assembled structure. |
| Conc | 4mM |
| Temperature | > 6 |
| Temperature | 37°C |
| Incubation Time | 2 hours |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Heterogenous chiral Nanostructures (Nanohelix) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable for 24 hours | |
| Nanohelicals | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1203, |
| PMID | 26018930 |
| Peptide Name | Ferrocene-FF |
| Peptide sequence | FF |
| N-Terminal Modification | Ferrocene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | TEM (Transmission Electron Microscopy), SEM (Scanning Electron Microscopy) |
| Solvent | Ethylenediamine + 10% HFIP (1,1,1,3,3,3-hexafluoro-2-propanol) and 90% H2O (v/ v) |
| Method | Peptide powder was dissolved in 1,1,1,3,3,3-hexafluoro-2-propanol (HFIP) at a concentration of 20 mM. The Fc-FF HFIP solution (100 μL) was then injected into a 20 mM, pH 5.6 ethylenediamine solution (900 μL) to yield a mixture of 10% HFIP and 90% H2O (v/ v) with 4 mM. This suspension was incubated at 37 °C for 2 h without disturbance to form self assembled structure. |
| Conc | 4mM |
| Temperature | 5.6 |
| Temperature | 37°C |
| Incubation Time | 2 hours |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Right Handed Chiral Nanostructure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanohelicals | |
| 150 | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1204, |
| PMID | 26018930 |
| Peptide Name | Ferrocene-FF |
| Peptide sequence | FF |
| N-Terminal Modification | Ferrocene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | TEM (Transmission Electron Microscopy), SEM (Scanning Electron Microscopy) |
| Solvent | 1, 4- diaminobutane + 10% HFIP (1,1,1,3,3,3-hexafluoro-2-propanol) and 90% H2O (v/ v) |
| Method | Peptide powder was dissolved in 1,1,1,3,3,3-hexafluoro-2-propanol (HFIP) at a concentration of 20 mM. The Fc-FF HFIP solution (100 μL) was then injected into a1, 4- diaminobutane to yield a mixture of 10% HFIP and 90% H2O (v/ v) with 4 mM. This suspension was incubated at 37 °C for 2 h without disturbance to form self assembled structure. |
| Conc | 4mM |
| Temperature | 5.6 |
| Temperature | 37°C |
| Incubation Time | 2 hours |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Amorphous aggregate |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| None | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1205, |
| PMID | 26018930 |
| Peptide Name | Ferrocene-FF |
| Peptide sequence | FF |
| N-Terminal Modification | Ferrocene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | TEM (Transmission Electron Microscopy), SEM (Scanning Electron Microscopy) |
| Solvent | Na+ and K+ |
| Method | Peptide powder was dissolved in 1,1,1,3,3,3-hexafluoro-2-propanol (HFIP) at a concentration of 20 mM. The Fc-FF HFIP solution (100 μL) in presence of NA+, or K+ ions yield a mixture of 10% HFIP and 90% H2O (v/ v) with 4 mM. This suspension was incubated at 37 °C for 2 h without disturbance to form self assembled structure. |
| Conc | 4mM |
| Temperature | 5.6 |
| Temperature | 37°C |
| Incubation Time | 2 hours |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Rectangular microtube |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Others | |
| 1000 | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1206, |
| PMID | 26018930 |
| Peptide Name | Ferrocene-FF |
| Peptide sequence | FF |
| N-Terminal Modification | Ferrocene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | TEM (Transmission Electron Microscopy), SEM (Scanning Electron Microscopy) |
| Solvent | 10% HFIP (1,1,1,3,3,3-hexafluoro-2-propanol) and 90% H2O (v/ v) |
| Method | Peptide powder was dissolved in 1,1,1,3,3,3-hexafluoro-2-propanol (HFIP) at a concentration of 4 mM. To yield a mixture of 10% HFIP and 90% H2O (v/ v) with 4 mM peptide conc. The turbid yellow suspension was incubated at 37 °C for 2 h without disturbance to form self assembled structure. |
| Conc | 4mM |
| Temperature | 5.6 |
| Temperature | < 30°C |
| Incubation Time | 2 hours |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Thick microbelt |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Others | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1207, |
| PMID | 26018930 |
| Peptide Name | Ferrocene-FF |
| Peptide sequence | FF |
| N-Terminal Modification | Ferrocene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | TEM (Transmission Electron Microscopy), SEM (Scanning Electron Microscopy) |
| Solvent | 10% HFIP (1,1,1,3,3,3-hexafluoro-2-propanol) and 90% H2O (v/ v) |
| Method | Peptide powder was dissolved in 1,1,1,3,3,3-hexafluoro-2-propanol (HFIP) at a concentration of 4 mM. To yield a mixture of 10% HFIP and 90% H2O (v/ v) with 4 mM peptide conc. The turbid yellow suspension was incubated at 37 °C for 2 h without disturbance to form self assembled structure. |
| Conc | 4mM |
| Temperature | 5.6 |
| Temperature | > 37°C |
| Incubation Time | 2 hours |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Big twist |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable at temperature > 37°C for 48 hours; Unstable at < 37°C | |
| Nanoribbon | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1208, |
| PMID | 26018930 |
| Peptide Name | Ferrocene-FF |
| Peptide sequence | FF |
| N-Terminal Modification | Ferrocene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | TEM (Transmission Electron Microscopy), SEM (Scanning Electron Microscopy) |
| Solvent | 10% 2-propanol/ 90% H2O |
| Method | Peptide powder was dissolved in 2-propanol) at a concentration of 4 mM. To yield a mixture of 10% 2-propanol and 90% H2O (v/ v) with 4 mM peptide conc. The suspension was incubated at 37 °C for 2 h without disturbance to form self assembled structure. |
| Conc | 4mM |
| Temperature | 5.6 |
| Temperature | 37°C |
| Incubation Time | 2 hours |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Nanoribbon(twist) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanoribbon | |
| 100 | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1209, |
| PMID | 26018930 |
| Peptide Name | Ferrocene-FF |
| Peptide sequence | FF |
| N-Terminal Modification | Ferrocene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | TEM (Transmission Electron Microscopy), SEM (Scanning Electron Microscopy) |
| Solvent | 10% acetonitrile + 90% H2O, |
| Method | Peptide powder was dissolved in acetonitrile at a concentration of 4 mM. To yield a mixture of 10% HFIP and 90% H2O (v/ v) with 4 mM peptide conc. The turbid yellow suspension was incubated at 37 °C for 2 h without disturbance to form self assembled structure. |
| Conc | 4mM |
| Temperature | 5.6 |
| Temperature | 37°C |
| Incubation Time | 2 hours |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Nanoribbon(twist) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanoribbon | |
| 200 | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1210, |
| PMID | 26018930 |
| Peptide Name | Ferrocene-FF |
| Peptide sequence | FF |
| N-Terminal Modification | Ferrocene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | TEM (Transmission Electron Microscopy), SEM (Scanning Electron Microscopy) |
| Solvent | 10% acetonitrile and 90% H2O (20 mM piperazine) |
| Method | Peptide powder was dissolved in acetonitrile at a concentration of 20 mM. this solution was then injected into a 20 mM, pH 5.6 piperazine buffer solution (900 μL) to yield a mixture of 10% acetonitrile and 90% H2O (v/ v) with 4 mM. The suspension was incubated at 37 °C for 2 h without disturbance to form self assembled structure. |
| Conc | 4 mM |
| Temperature | 5.6 |
| Temperature | 50°C |
| Incubation Time | 2 hours |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Nanoscrew |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Others | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1211, |
| PMID | 26018930 |
| Peptide Name | Ferrocene-FF |
| Peptide sequence | FF |
| N-Terminal Modification | Ferrocene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | TEM (Transmission Electron Microscopy), SEM (Scanning Electron Microscopy) |
| Solvent | 10% 2-propanol and 90% PBS solution (100 mM) |
| Method | Peptide powder was dissolved in 2-propanol at a concentration of 4 mM. To yield a mixture of 10% 2-propanol and 90% PBS (v/ v) with 4 mM peptide conc. This suspension was incubated at 37 °C for 2 h without disturbance to form self assembled structure. |
| Conc | 4 mM |
| Temperature | 5.6 |
| Temperature | 37°C |
| Incubation Time | 2 hours |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Nanotube |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanotube | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1214, |
| PMID | 25775220 |
| Peptide Name | 2-Thiopene diphenyl alanine |
| Peptide sequence | FF |
| N-Terminal Modification | 2-thiopene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Water + Sodium hydroxide |
| Method | The gelator was added to 2 mL of water with an equimolar amount of sodium hydroxide (0.1 M, aqueous). For solutions prepared with potassium carbonate and potassium hydroxide again an equimolar amount of 0.1 M solutions were used. The solution was stirred until all the gelator was dissolved. This solution was then transferred to a vial containing a 2.5 mg/mL of glucono-δ-lactone (GdL) and shaken gently. This was then left to stand to allow gelation to occur within a few hours. |
| Conc | 2.5 mg/mL |
| Temperature | 11 |
| Temperature | Room temperature |
| Incubation Time | 16 hours |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Transparent gel (containing Nanofibres) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1215, |
| PMID | 25775220 |
| Peptide Name | 2-Thiopene diphenyl alanine |
| Peptide sequence | FF |
| N-Terminal Modification | 2-thiopene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Water + Sodium hydroxide |
| Method | The gelator was added to 2 mL of water with an equimolar amount of sodium hydroxide (0.1 M, aqueous). For solutions prepared with potassium carbonate and potassium hydroxide again an equimolar amount of 0.1 M solutions were used. The solution was stirred until all the gelator was dissolved. This solution was then transferred to a vial containing a 2.5 mg/mL of glucono-δ-lactone (GdL) and shaken gently. This was then left to stand to allow gelation to occur within a few hours. |
| Conc | 2.5 mg/mL |
| Temperature | 11 |
| Temperature | Room temperature |
| Incubation Time | 72 hours |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Turbid gel (containing Nanospheres) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| 1000 | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1216, |
| PMID | 24482003 |
| Peptide Name | Peptide-porphyrin |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy), AFM (Atomic Force Microscopy) and TEM (Transmission Electron Microscopy) |
| Solvent | Water+Sulfonated porphyrin |
| Method | 2 mg FF was first dissolved in a 20 μL aqueous solution of HCl (1 M), followed by dilution with an 1mM aqueous solution of anionic tetrakis(4-sulfonatophenyl)porphine ([H2TPPS]). Final concentrations of [H2TPPS] and FF were 0.1 mM and 6.4 mM, respectively and pH was 1.9. Mixing the solutions gave a green turbid suspension that was aged for 2 days. Microspheres were separated and collected from the aqueous suspension by centrifugation |
| Conc | 6.4mM |
| Temperature | 1.9 |
| Temperature | Room temperature |
| Incubation Time | 48 hours |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Microsphere |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable against photodegradation | |
| Others | |
| 4000 | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1217, |
| PMID | 25621167 |
| Peptide Name | Diphenylalanine |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | FE - SEM (Field Emission Scanning Electron Microscopy or FE - SEM) |
| Solvent | Water |
| Method | Fresh stock solutions of Phe were prepared by dissolving Phe in distilled water at concentrations of 10, 25, 50, 100, and 150 mM. Fibril structure formed by following two techniques: (1)Conventional drop-casting: 3 mL of Phe–Phe solution was dropped on a clean stainless steel substrate and allowed to dry at 25°C in a vacuum for 12 h prior to subsequent characterization; (2) Directional freeze-drying: 1.5 mL of Phe–Phe solution was pipetted into a 2 mL centrifuge tube. The tube was placed into liquid nitrogen or a 20°C or 80°C freezer |
| Conc | 2mM |
| Temperature | 7 |
| Temperature | (-)20°C |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Nanofiber |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanofibers | |
| 10000 | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1229, |
| PMID | 25354784 |
| Peptide Name | Compound 1 |
| Peptide sequence | FF |
| N-Terminal Modification | Indole acetic acid |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | TEM (Transmission Electron Microscopy), AFM (Atomic Force Microscopy) |
| Solvent | 1mM Phosphate buffer saline |
| Method | Compound 1 dissolved in 1mM PBS(phosphate buffer saline) ,the solution is heated to 90°C and allowed to cool, forming a transparent gel that gradually changes to an opaque gel over time. |
| Conc | 1% w/v |
| Temperature | Heated at 90°C and followed by cooling |
| Incubation Time | 30 minutes - 12hours |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel (Containing Nanofibres) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable hydogel but degraded in conc. NaCl solution | |
| Hydrogel | |
| 250 | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1230, |
| PMID | 25354784 |
| Peptide Name | Compound 1 |
| Peptide sequence | FF |
| N-Terminal Modification | Indole acetic acid |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | TEM (Transmission Electron Microscopy), AFM (Atomic Force Microscopy) |
| Solvent | DMSO + water |
| Method | Compound 1 dissolved in DMSO and diluted with water, in the soultion GdL (gluco-delta-lactone) is added to maintain the pH. Solution gelate with 30 minutes to 24 hours. |
| Conc | > 0.4% w/v |
| Incubation Time | 5 -10 minutes |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Transparent Gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable hydogel but degraded in conc. NaCl solution | |
| Hydrogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1231, |
| PMID | 25259412 |
| Peptide Name | FF |
| Peptide sequence | FF |
| N-Terminal Modification | Conjugate with TTF |
| C-Terminal Modification | Amidation |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Tetrathiafulvalene (TTF) |
| Technique | TEM (Transmission Electron Microscopy), AFM (Atomic Force Microscopy), UV - vis - NIR, FTIR and CD (Circular Dichroism spectroscopy) |
| Solvent | Chloroform |
| Method | The TTF-FF-NH2 gelator (11.7 mg, 20mM) was mixed in a 1ml solvent. The mixture was vortexed followed by sonication for few seconds and heated to dissolve. The sample was cooled to room temperature and left for few hours to gelation. |
| Conc | 20mM |
| Temperature | Room temperature |
| Incubation Time | 30 minutes |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Organogel (consists of Nanofibers) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| Magnetically induced | |
| Stable for months under ambient conditions | |
| Organogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1232, |
| PMID | 25259412 |
| Peptide Name | FF |
| Peptide sequence | FF |
| N-Terminal Modification | Conjugate with TTF |
| C-Terminal Modification | Amidation |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Tetrathiafulvalene (TTF) |
| Technique | TEM (Transmission Electron Microscopy), AFM (Atomic Force Microscopy), UV - vis - NIR, FTIR and CD (Circular Dichroism spectroscopy) |
| Solvent | Ethylacetate |
| Method | The TTF-FF-NH2 gelator (11.7 mg, 20mM) was mixed in a 1ml solvent. The mixture was vortexed followed by sonication for few seconds and heated to dissolve. The sample was cooled to room temperature and left for few hours to gelation. |
| Conc | 20mM |
| Temperature | Room temperature |
| Incubation Time | 12 hours |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Organogel (consists of Nanofibers) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| Magnetically induced | |
| Stable for months under ambient conditions | |
| Organogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1233, |
| PMID | 25198430 |
| Peptide Name | FF |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Methanol + HFIP (1,1,1,3,3,3-hexafluoro-2-propanol) |
| Method | Diphenylalanine (FF) first dissolved in 1,1,1,3,3,3-hexafluoro-2-propanol (HFIP) at a concentration of 100 mg/mL. The corresponding stock solution was then diluted to a final concentration of 1 mg/mL in methanol. |
| Conc | 1mg/ml |
| Temperature | ~64.7°C |
| Incubation Time | 3 - 20 minutes |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Microsphere with microtube |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| Artificial supersaturation caused by Joule heating effect using voltage 100V | |
| NA | |
| Others | |
| 7500 | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1235, |
| PMID | 25068387 |
| Peptide Name | NapFF |
| Peptide sequence | FF |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Napthalene |
| Technique | TEM (Transmission Electron Microscopy), Cryo - SEM (Scanning Electron Microscopy) |
| Solvent | Deionized water + 1M Sodium hydroxide + 0.5M HCl |
| Method | Peptide was initially suspended in 200 μL in Water. 1M NaOH added to dissolve the peptide and to lower the pH to 6-7 using HCl (0.5M) added. Homogenous gel formed after keeping it for 24 hours |
| Conc | > 0.5 w% |
| Temperature | pH 6 -7 |
| Incubation Time | 24 hours |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1241, |
| PMID | 20695592 |
| Peptide Name | Dipeptide 7 |
| Peptide sequence | FF |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Bromo-Napthalene |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Deionized water + 0.1 M Sodium hydroxide + glucono-δ-lactone (GdL) |
| Method | Stock solutions of dipeptide-conjugates at a concentration of (0.5 wt%) were prepared and equimolar NaOH (0.1M ) added to it. These were then diluted with pH 10 water to a number of concentrations. To adjust the pH, for each dipeptide-conjugate solution and required quantity of GdL is added to solution to ensure final pH between 3.2 -3.6. Samples were left to stand at least 24 h. |
| Conc | 0.5 wt% |
| Temperature | 3.4 +/- 0.2. |
| Temperature | Room temperature |
| Incubation Time | 24 hours |
| Year | 2010 |
| Self assembly | Yes |
| Type of Self assembly | Transparent Gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1247, |
| PMID | 20695592 |
| Peptide Name | Dipeptide 13 |
| Peptide sequence | FF |
| N-Terminal Modification | Bromo-Napthalene or napthalene derivative |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Nitrile-Napthalene |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Deionized water + 0.1 M Sodium hydroxide + glucono-δ-lactone (GdL) |
| Method | Stock solutions of dipeptide-conjugates at a concentration of (0.5 wt%) were prepared and equimolar NaOH (0.1M ) added to it. These were then diluted with pH 10 water to a number of concentrations. To adjust the pH, for each dipeptide-conjugate solution and required quantity of GdL is added to solution to ensure final pH between 3.2 -3.6. Samples were left to stand at least 24 h. |
| Conc | 0.5 wt% |
| Temperature | 3.4 +/- 0.2. |
| Temperature | Room temperature |
| Incubation Time | 24 hours |
| Year | 2010 |
| Self assembly | Yes |
| Type of Self assembly | Turbid Gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Others | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1253, |
| PMID | 22468743 |
| Peptide Name | Diphenylalanine |
| Peptide sequence | FF |
| N-Terminal Modification | Cyano-Napthalene or napthalene derivative |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | Insilico tools i.e, Coarse - grained molecular dynamics (MD) simulations and GROMACS software |
| Solvent | Water |
| Method | 40 MD simulations performed on a system consisting of 600 FF peptides at peptide concentrations: 155mg/mL |
| Conc | 155 mg/ml |
| Temperature | 37°C |
| Incubation Time | 60 - 1200 nanoseconds |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Flat bilayer with holes shape ( in 9/10 MD runs); Nanotube (in 1/10 MD runs) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanotube | |
| 5.35 | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1254, |
| PMID | 22468743 |
| Peptide Name | Diphenylalanine |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | Insilico tools i.e, Coarse - grained molecular dynamics (MD) simulations and GROMACS software |
| Solvent | Water |
| Method | 40 MD simulations performed on a system consisting of 600 FF peptides at peptide concentrations: 85mg/mL |
| Conc | 85 mg/ml |
| Temperature | 37°C |
| Incubation Time | 60 - 1200 nanoseconds |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Spherical vesicle ( in 7/10 MD runs); Nanotube (in 2/10 MD runs); Bialyer shape (in 1/10 MD runs) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Nanovesicle, Nanotube | |
| 9.2 | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1255, |
| PMID | 22468743 |
| Peptide Name | Diphenylalanine |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | Insilico tools i.e, Coarse - grained molecular dynamics (MD) simulations and GROMACS software |
| Solvent | Water |
| Method | 40 MD simulations performed on a system consisting of 600 FF peptides at peptide concentrations: 120mg/mL |
| Conc | 120 mg/ml |
| Temperature | 37°C |
| Incubation Time | 60 - 1200 nanoseconds |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | vesicle (in 3/10 MD runs); Nanotube ( in 3/10 MD runs); Flat bialyer with holes shape (in 4/10 MD runs) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanovesicle, Nanotube | |
| 9.2 | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1259, |
| PMID | 19496552 |
| Peptide Name | Diphenylalanine |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | AFM (Atomic Force Microscopy |
| Solvent | 1,1,1,3,3,3-hexafluoro-2-propanol (HFIP)/water |
| Method | Peptide was dissolved in HFIP (1,1,1,3,3,3-hexafluoro-2-propanol) at 100mg/ml conc., solution is further diluted with water at pH 6 to make final concenteration 2mg/ml. Peptide solutions were placed onto freshly cleaved mica substrates and and dried under nitrogen gas. |
| Conc | 2mg/ml |
| Temperature | 6 |
| Temperature | Room temperature |
| Year | 2009 |
| Self assembly | Yes |
| Type of Self assembly | Nanotube |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable at 120°C | |
| Nanotube | |
| 175 | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1269, |
| PMID | 19705843 |
| Peptide Name | Fmoc-FF |
| Peptide sequence | FF |
| N-Terminal Modification | Fmoc(fluorenylmethoxycarbonyl) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | TEM (Transmission Electron Microscopy), AFM (Atomic Force Microscopy) |
| Solvent | Water |
| Method | Peptide first dissolved in DMSO and then diluted in water to their final concentration 5mg/ml. Self assembled structure formed at room temperature |
| Conc | 5mg/ml |
| Temperature | pH 3 - 12 |
| Temperature | Room temperature |
| Year | 2009 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel (Tangled Fibrous Nano structure) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable at pH 3 - 12 | |
| Hydrogel | |
| 20 | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1274, |
| PMID | 20000323 |
| Peptide Name | Diphenylalanine |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy), AFM (Atomic Force Microscopy) |
| Solvent | Water |
| Method | Dipeptide was dissolved in solvent, at a concentration of 2 mg/mL at 70°C for 10 min and cooled to room temperature. Each peptide solution (50 μL) was then placed onto cleaned silicon wafers or glass slides and dried until the solvent evaporated and self assembled structure formed. |
| Conc | 2mg/ml |
| Temperature | 25°C |
| Year | 2009 |
| Self assembly | Yes |
| Type of Self assembly | Tubular Nanostructure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable in proteinase solution | |
| Nanotube | |
| 1650 | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1275, |
| PMID | 20000323 |
| Peptide Name | Diphenylalanine |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy), AFM (Atomic Force Microscopy) |
| Solvent | Methanol |
| Method | Dipeptide was dissolved in solvent, at a concentration of 2 mg/mL at 70°C for 10 min and cooled to room temperature. Each peptide solution (50 μL) was then placed onto cleaned silicon wafers or glass slides and dried until the solvent evaporated and self assembled structure formed. |
| Conc | 2mg/ml |
| Temperature | 25°C |
| Year | 2009 |
| Self assembly | Yes |
| Type of Self assembly | Tubular Nanostructure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable in proteinase solution | |
| Nanotube | |
| 1650 | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1276, |
| PMID | 20000323 |
| Peptide Name | Diphenylalanine |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy), AFM (Atomic Force Microscopy) |
| Solvent | Ethanol |
| Method | Dipeptide was dissolved in solvent, at a concentration of 2 mg/mL at 70°C for 10 min and cooled to room temperature. Each peptide solution (50 μL) was then placed onto cleaned silicon wafers or glass slides and dried until the solvent evaporated at 80°C and self assembled structure formed. |
| Conc | 2mg/ml |
| Temperature | 80°C |
| Year | 2009 |
| Self assembly | Yes |
| Type of Self assembly | Tubular Nanostructure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable in proteinase solution | |
| Nanotube | |
| 1650 | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1277, |
| PMID | 20000323 |
| Peptide Name | Diphenylalanine |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy), AFM (Atomic Force Microscopy) |
| Solvent | Acetone |
| Method | Dipeptide was dissolved in solvent, at a concentration of 2 mg/mL at 70°C for 10 min and cooled to room temperature. Each peptide solution (50 μL) was then placed onto cleaned silicon wafers or glass slides and dried until the solvent evaporated at 80° and self assembled structure formed. |
| Conc | 2mg/ml |
| Temperature | 80°C |
| Year | 2009 |
| Self assembly | Yes |
| Type of Self assembly | Nanovesicle |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable in proteinase solution | |
| Nanovesicle | |
| 1100 | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1278, |
| PMID | 20000323 |
| Peptide Name | Diphenylalanine |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy), AFM (Atomic Force Microscopy) |
| Solvent | Tetrahydrofuran (THF) |
| Method | Dipeptide was dissolved in solvent, at a concentration of 2 mg/mL at 70°C for 10 min and cooled to room temperature. Each peptide solution (50 μL) was then placed onto cleaned silicon wafers or glass slides and dried until the solvent evaporated and self assembled structure formed. |
| Conc | 2mg/ml |
| Temperature | 25°C |
| Year | 2009 |
| Self assembly | No |
| Type of Self assembly | No self assembled structure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| None | |
| NA | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1279, |
| PMID | 20000323 |
| Peptide Name | Diphenylalanine |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy), AFM (Atomic Force Microscopy) |
| Solvent | Chloroform |
| Method | Dipeptide was dissolved in solvent, at a concentration of 2 mg/mL at 70°C for 10 min and cooled to room temperature. Each peptide solution (50 μL) was then placed onto cleaned silicon wafers or glass slides and dried until the solvent evaporated and self assembled structure formed. |
| Conc | 2mg/ml |
| Temperature | 25°C |
| Year | 2009 |
| Self assembly | No |
| Type of Self assembly | No self assembled structure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| None | |
| NA | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1280, |
| PMID | 20000323 |
| Peptide Name | Diphenylalanine |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy), AFM (Atomic Force Microscopy) |
| Solvent | Toluene |
| Method | Dipeptide was dissolved in solvent, at a concentration of 2 mg/mL at 70°C for 10 min and cooled to room temperature. Each peptide solution (50 μL) was then placed onto cleaned silicon wafers or glass slides and dried until the solvent evaporated and self assembled structure formed. |
| Conc | 2mg/ml |
| Temperature | 25°C |
| Year | 2009 |
| Self assembly | No |
| Type of Self assembly | No self assembled structure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| None | |
| NA | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1281, |
| PMID | 20000323 |
| Peptide Name | Diphenylalanine |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy), AFM (Atomic Force Microscopy) |
| Solvent | Benzene |
| Method | Dipeptide was dissolved in solvent, at a concentration of 2 mg/mL at 70 °C for 10 min and cooled to room temperature. Each peptide solution (50 μL) was then placed onto cleaned silicon wafers or glass slides and dried until the solvent evaporated and self assembled structure formed. |
| Conc | 2mg/ml |
| Temperature | 25°C |
| Year | 2009 |
| Self assembly | No |
| Type of Self assembly | No self assembled structure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| None | |
| NA | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1284, |
| PMID | 22890605 |
| Peptide Name | CNNapFF |
| Peptide sequence | FF |
| N-Terminal Modification | CN-napthol |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | CN-napthol |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Sodium hydoxide(0.1 M ) |
| Method | A 0.5 wt% stock solution of dipeptide at pH 9 – 10 prepaed by adding 1 equivalent of sodium hydroxide solution 0.1 M solution) with stirring atleast for 1 hour to dissolve, PAG (1 molar equivalent) was added to this solution before leaving to stir overnight and it lowers the pH of solution to 6. To form gels, 2 mL of stock solution was placed in a 7 mL Sterilin cup for 14 hours and UV light was irradiated from a 40 W Spectroline X-series UV lamp (wavelength 254 nm) . |
| Conc | 5mg/ml |
| Temperature | 6 |
| Temperature | Room temperature |
| Incubation Time | 14 hours |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Turbid gel (Nanofibers) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| 70 | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1285, |
| PMID | 22890605 |
| Peptide Name | 7MeOFF |
| Peptide sequence | FF |
| N-Terminal Modification | 7-methoxt-2-napthol |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | 7-methoxt-2-napthol |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Sodium hydoxide(0.1 M ) |
| Method | A 0.5 wt% stock solution of dipeptide at pH 9 – 10 prepaed by adding 1 equivalent of sodium hydroxide solution 0.1 M solution) with stirring atleast for overnight to dissolve, PAG (1 molar equivalent) was added to this solution before leaving to stir overnight and it lowers the pH of solution to 6.3. To form gels, 2 mL of stock solution was placed in a 7 mL Sterilin cup for 14 hours and UV light was irradiated from a 40 W Spectroline X-series UV lamp (wavelength 254 nm) . |
| Conc | 5mg/ml |
| Temperature | 6.3 |
| Temperature | Room temperature |
| Incubation Time | 14 hours |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Turbid gel (Nanofibers) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| 10 | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1288, |
| PMID | 22890605 |
| Peptide Name | 2NapFF |
| Peptide sequence | FF |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Napthalene |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Sodium hydoxide(0.1 M ) |
| Method | A 0.5 wt% stock solution of dipeptide at pH 9 – 10 prepaed by adding 1 equivalent of sodium hydroxide solution 0.1 M solution) with stirring atleast for 1 hour to dissolve, PAG (1 molar equivalent) was added to this solution before leaving to stir overnight and it lower the pH of solution to 6.4. To form gels, 2 mL of stock solution was placed in a 7 mL Sterilin cup for 14 hours and UV light was irradiated from a 40 W Spectroline X-series UV lamp (wavelength 254 nm) . |
| Conc | 5mg/ml |
| Temperature | 6.4 |
| Temperature | Room temperature |
| Incubation Time | 14 hours |
| Year | 2012 |
| Self assembly | No |
| Type of Self assembly | No gel formation |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| None | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1289, |
| PMID | 22897679 |
| Peptide Name | (polyA-FF-ME) or Poly(N-acryloyl-L-phenylalanyl-L-phenylalanine methyl ester) |
| Peptide sequence | FF |
| N-Terminal Modification | Acryloyl |
| C-Terminal Modification | Methyl esterification |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Mixture |
| Conjugate partner | PVP (Polyvinylpyrrolidone) and BP (benzoyl peroxide) |
| Technique | HR - SEM (High Resolution Scanning Electron Microscopy) |
| Solvent | Methoxy-ethanol |
| Method | 30 mg of the vinylic monomer A-FF-ME, 10 mg PVP, and 2 mg of BP were added to 1 mL of nitrogen-bubbled 2-methoxy ethanol.The mixture was shaken at room temperature to dissolve the solids at conc 3% 1%, and 0.2% (w/v) AA-FF-ME, PVP, and BP, respectively. The mixture was then shaken at 75 οC for 18 h. The formed soluble polyA-FF-ME wasprecipitated as uniform nanoparticles by adding 100 μL of its solution to 1 mL distilled water. |
| Conc | 3% w/v |
| Temperature | 75°C |
| Incubation Time | 18 hours |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Nanoparticle |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable for more than 233 h of heating | |
| Nanoparticle | |
| 57 | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1301, |
| PMID | 23061818 |
| Peptide Name | Boc-Phe-Phe-OH and NH2-Phe-Phe-OH |
| Peptide sequence | FF |
| N-Terminal Modification | Boc (t-butoxycarbonyl) on 1st dipeptide |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Mixture |
| Conjugate partner | Boc-Phe-Phe-OH + NH2-Phe-Phe-OH |
| Technique | SEM (Scanning Electron Microscopy), HR - SEM (High Resolution Scanning Electron Microscopy), TEM (Transmission Electron Microscopy), AFM (Atomic force Microscopy) |
| Solvent | HFP (1,1,1,3,3,3-hexafluoro-2-propanol) + 50% ethanol + 16 mMNaCl |
| Method | To coassemble the two peptides, we dissolved each peptide in 1,1,1,3,3,3-hexafluoro-2-propanol (HFP) and diluted them in 50% ethanol. The polarized solvent allowed the selfassembly of peptides. |
| Conc | 5mg/ml (1st dipeptide) + 2mg/ml )2nd dipeptide |
| Temperature | ~ 4.5 |
| Temperature | Room temperature |
| Incubation Time | 10 -24 hours |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Spherical structures with branching fibers |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| Co-assembly of two dipeptides | |
| Stable upto at 70°C | |
| Others | |
| 800 | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1302, |
| PMID | 23061818 |
| Peptide Name | Boc-Phe-Phe-OH and NH2-Phe-Phe-OH |
| Peptide sequence | FF |
| N-Terminal Modification | Boc (t-butoxycarbonyl) on 1st dipeptide |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Mixture |
| Conjugate partner | Boc-Phe-Phe-OH + NH2-Phe-Phe-OH |
| Technique | SEM (Scanning Electron Microscopy), HR - SEM (High Resolution Scanning Electron Microscopy), TEM (Transmission Electron Microscopy), AFM (Atomic force Microscopy) |
| Solvent | HFP (1,1,1,3,3,3-hexafluoro-2-propanol) + 50% ethanol + 16 mMNaCl |
| Method | To coassemble the two peptides, we dissolved each peptide in 1,1,1,3,3,3-hexafluoro-2-propanol (HFP) and diluted them in 50% ethanol. The polarized solvent allowed the selfassembly of peptides. |
| Conc | 1mg/ml (1st dipeptide) + 1mg/ml )2nd dipeptide |
| Temperature | ~ 4.5 |
| Temperature | Room temperature |
| Incubation Time | 10 -24 hours |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | spherical structures |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| Co-assembly of two dipeptides | |
| Stable upto at 70°C | |
| Nanosphere | |
| 800 | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1303, |
| PMID | 23061818 |
| Peptide Name | Boc-Phe-Phe-OH and NH2-Phe-Phe-OH |
| Peptide sequence | FF |
| N-Terminal Modification | Boc (t-butoxycarbonyl) on 1st dipeptide |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Mixture |
| Conjugate partner | Boc-Phe-Phe-OH + NH2-Phe-Phe-OH |
| Technique | SEM (Scanning Electron Microscopy), HR - SEM (High Resolution Scanning Electron Microscopy), TEM (Transmission Electron Microscopy), AFM (Atomic force Microscopy) |
| Solvent | HFP (1,1,1,3,3,3-hexafluoro-2-propanol) + 50% ethanol + 16 mMNaCl |
| Method | To coassemble the two peptides, we dissolved each peptide in 1,1,1,3,3,3-hexafluoro-2-propanol (HFP) and diluted them in 50% ethanol. The polarized solvent allowed the selfassembly of peptides. |
| Conc | 2mg/ml (1st dipeptide) + 2mg/ml )2nd dipeptide |
| Temperature | ~ 4.5 |
| Temperature | Room temperature |
| Incubation Time | 10 -24 hours |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | spherical structures |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| Co-assembly of two dipeptides | |
| Stable upto at 70°C | |
| Nanosphere | |
| 800 | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1304, |
| PMID | 23061818 |
| Peptide Name | Boc-Phe-Phe-OH and NH2-Phe-Phe-OH |
| Peptide sequence | FF |
| N-Terminal Modification | Boc (t-butoxycarbonyl) on 1st dipeptide |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Mixture |
| Conjugate partner | Boc-Phe-Phe-OH + NH2-Phe-Phe-OH |
| Technique | SEM (Scanning Electron Microscopy), HR - SEM (High Resolution Scanning Electron Microscopy), TEM (Transmission Electron Microscopy), AFM (Atomic force Microscopy) |
| Solvent | HFP (1,1,1,3,3,3-hexafluoro-2-propanol) + 50% ethanol + 16 mMNaCl |
| Method | To coassemble the two peptides, we dissolved each peptide in 1,1,1,3,3,3-hexafluoro-2-propanol (HFP) and diluted them in 50% ethanol. The polarized solvent allowed the selfassembly of peptides. |
| Conc | 3mg/ml (1st dipeptide) + 3mg/ml )2nd dipeptide |
| Temperature | ~ 4.5 |
| Temperature | Room temperature |
| Incubation Time | 10 -24 hours |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Necklaces like Nanostructue |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| Co-assembly of two dipeptides | |
| Unstable at 70°C | |
| Others | |
| 550 | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1305, |
| PMID | 23061818 |
| Peptide Name | Boc-Phe-Phe-OH and NH2-Phe-Phe-OH |
| Peptide sequence | FF |
| N-Terminal Modification | Boc (t-butoxycarbonyl) on 1st dipeptide |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Mixture |
| Conjugate partner | Boc-Phe-Phe-OH + NH2-Phe-Phe-OH |
| Technique | SEM (Scanning Electron Microscopy), HR - SEM (High Resolution Scanning Electron Microscopy), TEM (Transmission Electron Microscopy), AFM (Atomic force Microscopy) |
| Solvent | HFP (1,1,1,3,3,3-hexafluoro-2-propanol) + 50% ethanol + 16 mMNaCl |
| Method | To coassemble the two peptides, we dissolved each peptide in 1,1,1,3,3,3-hexafluoro-2-propanol (HFP) and diluted them in 50% ethanol. The polarized solvent allowed the selfassembly of peptides. |
| Conc | 4mg/ml (1st dipeptide) +4mg/ml )2nd dipeptide |
| Temperature | ~ 4.5 |
| Temperature | Room temperature |
| Incubation Time | 10 -24 hours |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Necklaces like Nanostructue |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| Co-assembly of two dipeptides | |
| Unstable at 70°C | |
| Others | |
| 550 | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1306, |
| PMID | 23061818 |
| Peptide Name | Boc-Phe-Phe-OH and NH2-Phe-Phe-OH |
| Peptide sequence | FF |
| N-Terminal Modification | Boc (t-butoxycarbonyl) on 1st dipeptide |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Mixture |
| Conjugate partner | Boc-Phe-Phe-OH + NH2-Phe-Phe-OH |
| Technique | SEM (Scanning Electron Microscopy), HR - SEM (High Resolution Scanning Electron Microscopy), TEM (Transmission Electron Microscopy), AFM (Atomic force Microscopy) |
| Solvent | HFP (1,1,1,3,3,3-hexafluoro-2-propanol) + 50% ethanol + 16 mMNaCl |
| Method | To coassemble the two peptides, we dissolved each peptide in 1,1,1,3,3,3-hexafluoro-2-propanol (HFP) and diluted them in 50% ethanol. The polarized solvent allowed the selfassembly of peptides. |
| Conc | 3mg/ml (1st dipeptide) + 4mg/ml )2nd dipeptide |
| Temperature | ~ 4.5 |
| Temperature | Room temperature |
| Incubation Time | 10 -24 hours |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Necklaces like Nanostructue |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| Co-assembly of two dipeptides | |
| Unstable at 70°C | |
| Others | |
| 550 | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1307, |
| PMID | 23061818 |
| Peptide Name | Boc-Phe-Phe-OH and NH2-Phe-Phe-OH |
| Peptide sequence | FF |
| N-Terminal Modification | Boc (t-butoxycarbonyl) on 1st dipeptide |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Mixture |
| Conjugate partner | Boc-Phe-Phe-OH + NH2-Phe-Phe-OH |
| Technique | SEM (Scanning Electron Microscopy), HR - SEM (High Resolution Scanning Electron Microscopy), TEM (Transmission Electron Microscopy), AFM (Atomic force Microscopy) |
| Solvent | HFP (1,1,1,3,3,3-hexafluoro-2-propanol) + 50% ethanol + 16 mMNaCl |
| Method | To coassemble the two peptides, we dissolved each peptide in 1,1,1,3,3,3-hexafluoro-2-propanol (HFP) and diluted them in 50% ethanol. The polarized solvent allowed the selfassembly of peptides. |
| Conc | 3mg/ml (1st dipeptide) + 5mg/ml )2nd dipeptide |
| Temperature | ~ 4.5 |
| Temperature | Room temperature |
| Incubation Time | 10 -24 hours |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Necklaces like Nanostructue |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| Co-assembly of two dipeptides | |
| Unstable at 70°C | |
| Others | |
| 550 | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1308, |
| PMID | 23061818 |
| Peptide Name | Boc-Phe-Phe-OH and NH2-Phe-Phe-OH |
| Peptide sequence | FF |
| N-Terminal Modification | Boc (t-butoxycarbonyl) on 1st dipeptide |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Mixture |
| Conjugate partner | Boc-Phe-Phe-OH + NH2-Phe-Phe-OH |
| Technique | SEM (Scanning Electron Microscopy), HR - SEM (High Resolution Scanning Electron Microscopy), TEM (Transmission Electron Microscopy), AFM (Atomic force Microscopy) |
| Solvent | HFP (1,1,1,3,3,3-hexafluoro-2-propanol) + 50% ethanol + 16 mMNaCl |
| Method | To coassemble the two peptides, we dissolved each peptide in 1,1,1,3,3,3-hexafluoro-2-propanol (HFP) and diluted them in 50% ethanol. The polarized solvent allowed the selfassembly of peptides. |
| Conc | 5mg/ml (1st dipeptide) + 4mg/ml )2nd dipeptide |
| Temperature | ~ 4.5 |
| Temperature | Room temperature |
| Incubation Time | 10 -24 hours |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Necklaces like Nanostructue |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| Co-assembly of two dipeptides | |
| Unstable at 70°C | |
| Others | |
| 550 | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1329, |
| PMID | 23708750 |
| Peptide Name | Fc-Phe-Phe-OMe |
| Peptide sequence | FF |
| N-Terminal Modification | Ferrocene |
| C-Terminal Modification | Methoxy |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide derivative |
| Technique | SEM (Scanning Electron Microscopy) and TEM (Transmission Electron Microscopy) |
| Solvent | HFP (1,1,1,3,3,3-hexafluoro-2-propanol) + Methanol |
| Method | Fc-Phe–Phe-OMe was dissolved in 1,1,1,3,3,3-hexafluoro-2-propanol to produce a 100mg/mL stock solution. This solution was diluted with methanol to a concentration 2mg/mL. Nanowires produced upon evaporation of thes olvent at room temperature. |
| Conc | 2mg/ml |
| Temperature | Room temperature |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Nanowire |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Nanowire | |
| 7500 | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1330, |
| PMID | 23706149 |
| Peptide Name | Phe-Phe |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Etahnol |
| Method | 2mg of Peptide dissolved in 0.9 mL of ethanol at 70 °C for 10 min and then cooled to room temperature. To the peptide solution was then added 100 μLaliquot amounts of AuNPs (i.e., spherical, rod, or cage) dispersed in ethanol. After 3−4 h, each peptide−AuNP mixture (100 μL) was placed onto a glass slide or silicon wafer surfaces and dried at ambient temperature, until the solvent evaporated. The resultant dipeptide structures were characterized by SEM. |
| Conc | 2mg/ml |
| Temperature | Room temperature |
| Incubation Time | 3 - 4 hours |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Randomly ordered , dense tubular Nanostructures |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| Laser triggered and In presence of gold nanoparticle of 5 - 10 nm sized | |
| NA | |
| Nanoparticle | |
| NA | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1331, |
| PMID | 23706149 |
| Peptide Name | Phe-Phe |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Etahnol |
| Method | 2mg of Peptide dissolved in 0.9 mL of ethanol at 70 °C for 10 min and then cooled to room temperature. To the peptide solution was then added 100 μLaliquot amounts of AuNPs (i.e., spherical, rod, or cage) dispersed in ethanol. After 3−4 h, each peptide−AuNP mixture (100 μL) was placed onto a glass slide or silicon wafer surfaces and dried at ambient temperature, until the solvent evaporated. The resultant dipeptide structures were characterized by SEM. |
| Conc | 2mg/ml |
| Temperature | Room temperature |
| Incubation Time | 4 - 4 hours |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Star like morpholgy |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| Laser triggered and In presence of gold nanoparticle of 5 - 10 nm sized | |
| NA | |
| Others | |
| NA | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1332, |
| PMID | 23706149 |
| Peptide Name | Phe-Phe |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | HFIP (1,1,1,3,3,3-hexafluoro-2-Isopropanol)+Chloroform |
| Method | 0.40 M stock Phe−Phe solution was first prepared in 1,1,1,3,3,3-hexafluoro-2-propanol (HFIP) and then diluted chloroform to give a final concentration of 8.0 mM. Allow to keep at room temperature |
| Conc | 8mM |
| Temperature | Room temperature |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Organogel (Thick fibers) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Organogel | |
| NA | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1333, |
| PMID | 23706149 |
| Peptide Name | Phe-Phe |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | HFIP (1,1,1,3,3,3-hexafluoro-2-Isopropanol)+Chloroform |
| Method | 0.40 M stock Phe−Phe solution was first prepared in 1,1,1,3,3,3-hexafluoro-2-propanol (HFIP) and then diluted by AuNPs containing chloroform (3.0 × 1010 to 5.6 × 1011 particles/mL) to give a final concentration of 8.0 mM. allow to keep at room temperature. |
| Conc | 8mM |
| Temperature | Room temperature |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Organogel (Small fibres with varying length)) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| In presence of gold nanoparticles | |
| NA | |
| Organogel | |
| NA | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1355, |
| PMID | 24036697 |
| Peptide Name | CDP or H–Phe–Phe–NH2. HCl |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Amidation |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | Co-assemble with azobenzed molecule i.e. CPABS (4-[(3-carboxyl-4-hydroxy)phenylazo]benzenesulfonic acid) |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | HFIP (1,1,1,3,3,3-hexafluoro-2-Isopropanol) + water |
| Method | Peptide added to water and to dissolve peptide in solutioh 1,1,1,3,3,3-hexafluoro-2-propanol (HFIP) added. Upon adding aqueous solutions of azobenzenes i.e . CPABS to HFIP solution of CDP (in a 1 : 1 mole ratio) at room temperature, yellow precipitates formed rapidly, indicating generation of co-assembled nanostructures. |
| Temperature | Room temperature |
| Incubation Time | Several hours |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Microsphere |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| Coassembly with Azobenzene | |
| NA | |
| Others | |
| 2500 | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N | |
| Primary information | |
| SAPdb ID | 1356, |
| PMID | 24036697 |
| Peptide Name | CDP or H–Phe–Phe–NH2. HCl |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Amidation |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | Co-assemble with HPABS (4-[(4-hydroxy)phenylazo]benzenesulfonic acid) |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | HFIP (1,1,1,3,3,3-hexafluoro-2-Isopropanol) + water |
| Method | Peptide added to water and to dissolve peptide in solutioh 1,1,1,3,3,3-hexafluoro-2-propanol (HFIP) added. Upon adding aqueous solutions of azobenzenes i.e . CPABS to HFIP solution of CDP (in a 1 : 1 mole ratio) at room temperature, yellow precipitates formed rapidly, indicating generation of co-assembled nanostructures. |
| Temperature | Room temperature |
| Incubation Time | Several hours |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Flower like Nanostructures |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| Coassembly with Azobenzene | |
| NA | |
| Others | |
| 15000 | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N | |
| Primary information | |
| SAPdb ID | 1357, |
| PMID | 24036697 |
| Peptide Name | CDP or H–Phe–Phe–NH2. HCl |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Amidation |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | Co-assemble with MO (Methyl orange) |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | HFIP (1,1,1,3,3,3-hexafluoro-2-Isopropanol) + water |
| Method | Peptide added to water and to dissolve peptide in solutioh 1,1,1,3,3,3-hexafluoro-2-propanol (HFIP) added. Upon adding aqueous solutions of azobenzenes i.e . CPABS to HFIP solution of CDP (in a 1 : 1 mole ratio) at room temperature, yellow precipitates formed rapidly, indicating generation of co-assembled nanostructures. |
| Temperature | Room temperature |
| Incubation Time | Several hours |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Plate like Nanostructure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Others | |
| 2000 | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N | |
| Primary information | |
| SAPdb ID | 1383, |
| PMID | 24611281 |
| Peptide Name | Diphenylalanine |
| Peptide sequence | FF |
| N-Terminal Modification | Fmoc(fluorenylmethoxycarbonyl) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide derivative |
| Technique | AFM (Atomic Force Microscopy |
| Solvent | HFIP (1,1,1,3,3,3-hexafluoro-2-Isopropanol) |
| Method | Solutions (0.5 mg/ml) of Phe-Phe in HFIP prepared . This solution was used to spin cast dipeptide molecules onto the mica substrate. Spin casting was performed drop dropwise at 1000rpm. But instead of casting mica Dendritic structure formed on mica surface. |
| Conc | 0.5mg/ml |
| Temperature | 20°C |
| Incubation Time | 24 hours |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Dendritic patterns of Nanofibers |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable under ambient conditions atleast for 4 months | |
| Nanofibers | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1404, |
| PMID | 25155031 |
| Peptide Name | Diphenylalanine |
| Peptide sequence | FF |
| N-Terminal Modification | Fmoc(fluorenylmethoxycarbonyl) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide derivative |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | DMSO + Water (in non-equilibrium phase) |
| Method | Peptide(1mg) was dissolved in DMSO at selected concentrations, followed by sample was mixed for 1–2 minutes until the solid was fully dissolved in the solvent. Gelation of the samples was triggered by the addition of water at various ratios in order to obtain the desired nal concentration. |
| Temperature | Room temperature |
| Incubation Time | < 5 minutes |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Spherical clusters |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanosphere | |
| 2000 | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1405, |
| PMID | 25155031 |
| Peptide Name | Diphenylalanine |
| Peptide sequence | FF |
| N-Terminal Modification | Fmoc(fluorenylmethoxycarbonyl) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide derivative |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | DMSO + Water (in equilibrium phase) |
| Method | Peptide(1mg) was dissolved in DMSO at selected concentrations, followed by sample was mixed for 1–2 minutes until the solid was fully dissolved in the solvent. Gelation of the samples was triggered by the addition of water at various ratios in order to obtain the desired nal concentration. |
| Temperature | Room temperature |
| Incubation Time | > 5 - 30 minutes |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Nanofibers |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanofibers | |
| 7.5 | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1407, |
| PMID | 25229206 |
| Peptide Name | NDI-Phe-Phe or 1 |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Mixture |
| Conjugate partner | NDI : 1,4,5,8-naphthalenetetracarboxylic acid diimide |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water |
| Method | 2mg compound was dissolved in 0.2ml solvent by heating. Gelation occur at room temperature. |
| Conc | 2% wt |
| Temperature | pH 4.8 |
| Temperature | Room temperature |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Hydrogel | |
| NA | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1411, |
| PMID | 25229206 |
| Peptide Name | NDI-Phe-Phe or 1 |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Mixture |
| Conjugate partner | NDI : 1,4,5,8-naphthalenetetracarboxylic acid diimide |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water |
| Method | 2mg compound was dissolved in 0.2ml solvent by heating. Gelation occur at room temperature. |
| Conc | 2% wt |
| Temperature | pH 7.4 |
| Temperature | Room temperature |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Semitranslucent Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Hydrogel | |
| NA | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1415, |
| PMID | 25391268 |
| Peptide Name | Boc-diphenylalanine |
| Peptide sequence | FF |
| N-Terminal Modification | Boc (t-butoxycarbonyl) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | HR - SEM (High Resolution Scanning Electron Microscopy) and DLS (Dynamic light scattering) |
| Solvent | 10% ethanol in water |
| Method | Dipeptide dissolved in 10% ethanol( in water) at conc 0.2 - 10mg/ml in a vial. Vial sealed to avoid evaporation and allowed to equilibrate for 1 h prior to measurement. |
| Conc | 0.2 - 10mg/ml |
| Temperature | Room temperature |
| Incubation Time | < 20 minutes |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Spherical structures |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Transient stable | |
| Nanosphere | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1416, |
| PMID | 25391268 |
| Peptide Name | Boc-diphenylalanine |
| Peptide sequence | FF |
| N-Terminal Modification | Boc (t-butoxycarbonyl) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | HR - SEM (High Resolution Scanning Electron Microscopy) and DLS (Dynamic light scattering) |
| Solvent | 10% ethanol in water |
| Method | Dipeptide dissolved in 10% ethanol( in water) at conc 0.2 - 10mg/ml in a vial. Vial sealed to avoid evaporation and allowed to equilibrate for 1 h prior to measurement. |
| Conc | 0.2 - 10mg/ml |
| Temperature | Room temperature |
| Incubation Time | 30 - 40 minutes |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Fibril Nanostructure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Transient stable | |
| Nanofibers | |
| 30 | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1417, |
| PMID | 25391268 |
| Peptide Name | Boc-diphenylalanine |
| Peptide sequence | FF |
| N-Terminal Modification | Boc (t-butoxycarbonyl) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | HR - SEM (High Resolution Scanning Electron Microscopy) and DLS (Dynamic light scattering) |
| Solvent | 10% ethanol in water |
| Method | Dipeptide dissolved in 10% ethanol( in water) at conc 0.2 - 10mg/ml in a vial. Vial sealed to avoid evaporation and allowed to equilibrate for 1 h prior to measurement. |
| Conc | 0.2 - 10mg/ml |
| Temperature | Room temperature |
| Incubation Time | 60 minutes |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Nanotube |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Nanotube | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1441, |
| PMID | 23566763 |
| Peptide Name | Fmoc-FF |
| Peptide sequence | FF |
| N-Terminal Modification | Fmoc(fluorenylmethoxycarbonyl) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy) and DLS (Dynamic Light Scattering) |
| Solvent | DMSO + water + vitamin E-TPGS |
| Method | Peptide dissolved in water at concentration of 10 mg/mL. The resulting solution was added drop-wise into 50 mL slightly warmed ( 35 °C) mineral oil containing vitamin E-TPGS atconcentration of 0.4% wt/v and homogenized . Next, nanoparticles were allowed to self-assemble for 2 h with continues stirring at 4 °C. After completion the self assembly process, the resulting suspension was mixed with hexane at a concentration of 20% (v/v), and centrifuged to obtain self assembled nanoparticle. |
| Conc | 10mg/ml |
| Temperature | 4 °C |
| Incubation Time | 2 hours |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel Nanoparticle (HNP) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable under physiological conditions | |
| Hydrogel | |
| 100 | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1451, |
| PMID | 24301009 |
| Peptide Name | NH2-Phe-Phe-OH |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | TEM (Transmission Electron Microscopy), SEM (Scanning Electron Microscopy) and AFM (Atomic Force Microscopy) |
| Solvent | HFP (1,1,1,3,3,3-hexafluoro-2-propanol) + water |
| Method | Peptide dissolved in HFP at conc 100mg/ml and solution is vortexed. Finally solution is diluted with water at final conc 2mg/ml. Solution is kept at room temperature for 24 hours. |
| Conc | 2mg/ml |
| Temperature | Room temperature |
| Incubation Time | 24 hours |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Nanotube |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanotube | |
| NA | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1452, |
| PMID | 24301009 |
| Peptide Name | Boc-Phe-Phe-COOH |
| Peptide sequence | FF |
| N-Terminal Modification | Boc (t-butoxycarbonyl) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | TEM (Transmission Electron Microscopy), SEM (Scanning Electron Microscopy) and AFM (Atomic Force Microscopy) |
| Solvent | HFP (1,1,1,3,3,3-hexafluoro-2-propanol) + Ethanol |
| Method | Peptide dissolved in HFP at conc 100mg/ml and solution is vortexed. Finally solution is diluted with ethanol at final conc 2mg/ml. Solution is kept at room temperature for 24 hours. |
| Conc | 5mg/ml |
| Temperature | Room temperature |
| Incubation Time | 24 hours |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Nanosphere |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanosphere | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1453, |
| PMID | 24301009 |
| Peptide Name | NH2-Phe-Phe-OH + Boc-Phe-Phe-COOH |
| Peptide sequence | FF |
| N-Terminal Modification | Boc (t-butoxycarbonyl) at 2nd dipeptide |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Mixture |
| Conjugate partner | Mixture of two dipeptides |
| Technique | TEM (Transmission Electron Microscopy), SEM (Scanning Electron Microscopy) and AFM (Atomic Force Microscopy) |
| Solvent | HFP+50 % Ethanol |
| Method | Peptide dissolved in HFP at conc 100mg/ml and solution is vortexed. Finally solution is diluted with ethanol at final conc 2mg/ml. Solution is kept at room temperature for 24 hours. |
| Conc | 5mg/ml (1st dipeptide) and 3mg/ml (2nd dipeptide) |
| Temperature | Room temperature |
| Incubation Time | 24 hours |
| Year | 2013 |
| Self assembly | Yes |
| Type of Self assembly | Necklaces like Nanostructue |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Others | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1454, |
| PMID | 24422499 |
| Peptide Name | Diphenylalanine |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Isopropanol |
| Method | Peptide supersaturated solution placed on a glass slide and solutions in various solvents were placed on a glass slide and were left to dry at room temperature. |
| Conc | 2.6 x 10 -4 M |
| Temperature | Room temperature |
| Incubation Time | 24 - 48 hours |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Lamellar |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Others | |
| NA | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1455, |
| PMID | 24422499 |
| Peptide Name | Diphenylalanine |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Formamide solution |
| Method | Peptide supersaturated solution placed on a glass slide and solutions in various solvents were placed on a glass slide and were left to dry at room temperature. |
| Conc | 2.6 x 10 -4 M |
| Temperature | Room temperature |
| Incubation Time | 24 - 48 hours |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Translucent gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1456, |
| PMID | 24889029 |
| Peptide Name | Peptide 1 or H-Phe(4-azido)-Phe(4-azido)-OH |
| Peptide sequence | FF |
| N-Terminal Modification | 4-azido |
| C-Terminal Modification | 4-azido |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide derivative |
| Technique | HR - SEM (High Resolution - Scanning Electron Microscopy), STEM (Scanning Transmission Electron Microscopy) and AFM (Atomic Force Microscopy) |
| Solvent | 50% ethanol |
| Method | Stock solution of dipeptide prepared in HFP at conc 100mg/ml. Peptide solution is diluted with 50 % ethanol in final concentration of 5mg/ml. peptide solution kept in dark at room temperature for 24 hours. |
| Conc | 5mg/ml |
| Temperature | Room temperature |
| Incubation Time | 24 hours |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Spherical and porous structure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Others | |
| 1150 | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1457, |
| PMID | 24889029 |
| Peptide Name | Peptide 2 or H-Phe-Phe(4-azido)-OH |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | 4-azido |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide derivative |
| Technique | HR - SEM (High Resolution - Scanning Electron Microscopy), STEM (Scanning Transmission Electron Microscopy) and AFM (Atomic Force Microscopy) |
| Solvent | 50% ethanol |
| Method | Stock solution of dipeptide prepared in HFP at conc 100mg/ml. Peptide solution is diluted with 50 % ethanol in final concentration of 5mg/ml. peptide solution kept in dark at room temperature for 24 hours. |
| Conc | 5mg/ml |
| Temperature | Room temperature |
| Incubation Time | 24 hours |
| Year | 2014 |
| Self assembly | No |
| Type of Self assembly | No assembled structure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| None | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1458, |
| PMID | 24889029 |
| Peptide Name | Peptide 3 or H-Phe(4-azido)-Phe-OH |
| Peptide sequence | FF |
| N-Terminal Modification | 4-azido |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide derivative |
| Technique | HR - SEM (High Resolution - Scanning Electron Microscopy), STEM (Scanning Transmission Electron Microscopy) and AFM (Atomic Force Microscopy) |
| Solvent | 50% ethanol |
| Method | Stock solution of dipeptide prepared in HFP at conc 100mg/ml. Peptide solution is diluted with 50 % ethanol in final concentration of 5mg/ml. peptide solution kept in dark at room temperature for 24 hours. |
| Conc | 5mg/ml |
| Temperature | Room temperature |
| Incubation Time | 24 hours |
| Year | 2014 |
| Self assembly | No |
| Type of Self assembly | No assembled structure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| None | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1459, |
| PMID | 24889029 |
| Peptide Name | Peptide 1 or H-Phe(4-azido)-Phe(4-azido)-OH |
| Peptide sequence | FF |
| N-Terminal Modification | 4-azido |
| C-Terminal Modification | 4-azido |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide derivative |
| Technique | HR - SEM (High Resolution - Scanning Electron Microscopy), STEM (Scanning Transmission Electron Microscopy) and AFM (Atomic Force Microscopy) |
| Solvent | TDW (Tripple Distilled Water) |
| Method | Stock solution of dipeptide prepared in HFP at conc 100mg/ml. Peptide solution is diluted with TDW (Tripple Distilled Water) in final concentration of 5mg/ml. peptide solution kept in dark at room temperature for 24 hours. |
| Conc | 5mg/ml |
| Temperature | Room temperature |
| Incubation Time | 24 hours |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Spherical and porous structure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Others | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1460, |
| PMID | 24889029 |
| Peptide Name | Peptide 2 or H-Phe-Phe(4-azido)-OH |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | 4-azido |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide derivative |
| Technique | HR - SEM (High Resolution - Scanning Electron Microscopy), STEM (Scanning Transmission Electron Microscopy) and AFM (Atomic Force Microscopy) |
| Solvent | TDW (Tripple Distilled Water) |
| Method | Stock solution of dipeptide prepared in HFP at conc 100mg/ml. Peptide solution is diluted with TDW (Tripple Distilled Water) in final concentration of 5mg/ml. peptide solution kept in dark at room temperature for 24 hours. |
| Conc | 5mg/ml |
| Temperature | Room temperature |
| Incubation Time | 24 hours |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Spherical structure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Nanosphere | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1461, |
| PMID | 24889029 |
| Peptide Name | Peptide 3 or H-Phe(4-azido)-Phe-OH |
| Peptide sequence | FF |
| N-Terminal Modification | 4-azido |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide derivative |
| Technique | HR - SEM (High Resolution - Scanning Electron Microscopy), STEM (Scanning Transmission Electron Microscopy) and AFM (Atomic Force Microscopy) |
| Solvent | TDW (Tripple Distilled Water) |
| Method | Stock solution of dipeptide prepared in HFP at conc 100mg/ml. Peptide solution is diluted with TDW (Tripple Distilled Water) in final concentration of 5mg/ml. peptide solution kept in dark at room temperature for 24 hours. |
| Conc | 5mg/ml |
| Temperature | Room temperature |
| Incubation Time | 24 hours |
| Year | 2014 |
| Self assembly | No |
| Type of Self assembly | No assembled structure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| None | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1462, |
| PMID | 24889029 |
| Peptide Name | Peptide 1 or H-Phe(4-azido)-Phe(4-azido)-OH + Peptide 5 or Boc-Phe-Phe-OH |
| Peptide sequence | FF |
| N-Terminal Modification | 4-azido |
| C-Terminal Modification | 4-azido |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide derivative |
| Technique | HR - SEM (High Resolution - Scanning Electron Microscopy), STEM (Scanning Transmission Electron Microscopy) and AFM (Atomic Force Microscopy) |
| Solvent | 50% ethanol |
| Method | To co-assemble the peptides, both peptides dissolved individually in HFP to a concentration of 100mg/ml. The desired combination of peptides was blended by mixing the peptides in HFP in the desired ratio to form a combination stock solution. The peptide combination stock solution was then diluted to a desired final concentration. peptide solution kept in dark at room temperature for 24 hours. |
| Conc | 5mg/ml of peptide 1, and 3mg/ml of peptide 5 |
| Temperature | Room temperature |
| Incubation Time | 24 hours |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Aggregate of spherical assemblies |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| Co-assembly | |
| NA | |
| Others | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1463, |
| PMID | 24889029 |
| Peptide Name | Peptide 1 or H-Phe(4-azido)-Phe(4-azido)-OH + Peptide 4 or H-Phe-Phe-OH |
| Peptide sequence | FF |
| N-Terminal Modification | 4-azido |
| C-Terminal Modification | 4-azido |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide derivative |
| Technique | HR - SEM (High Resolution - Scanning Electron Microscopy), STEM (Scanning Transmission Electron Microscopy) and AFM (Atomic Force Microscopy) |
| Solvent | 50% ethanol |
| Method | To co-assemble the peptides, both peptides dissolved individually in HFP to a concentration of 100mg/ml. The desired combination of peptides was blended by mixing the peptides in HFP in the desired ratio to form a combination stock solution. The peptide combination stock solution was then diluted to a desired final concentration. peptide solution kept in dark at room temperature for 24 hours. |
| Conc | 5mg/ml of peptide 1, and 3mg/ml of peptide 4 |
| Temperature | Room temperature |
| Incubation Time | 24 hours |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Aggregate of spherical assemblies |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| Co-assembly | |
| NA | |
| Others | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1464, |
| PMID | 24889029 |
| Peptide Name | Peptide 1 or H-Phe(4-azido)-Phe(4-azido)-OH + Peptide 4 or H-Phe-Phe-OH |
| Peptide sequence | FF |
| N-Terminal Modification | 4-azido |
| C-Terminal Modification | 4-azido |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide derivative |
| Technique | HR - SEM (High Resolution - Scanning Electron Microscopy), STEM (Scanning Transmission Electron Microscopy) and AFM (Atomic Force Microscopy) |
| Solvent | TDW (Tripple Distilled Water) |
| Method | To co-assemble the peptides, both peptides dissolved individually in HFP to a concentration of 100mg/ml. The desired combination of peptides was blended by mixing the peptides in HFP in the desired ratio to form a combination stock solution. The peptide combination stock solution was then diluted to a desired final concentration. peptide solution kept in dark at room temperature for 24 hours. |
| Conc | 5mg/ml of peptide 1, and 3mg/ml of peptide 4 |
| Temperature | Room temperature |
| Incubation Time | 24 hours |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Aggregate of tubular structure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| Co-assembly | |
| NA | |
| Others | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1465, |
| PMID | 24889029 |
| Peptide Name | Peptide 3 or H-Phe(4-azido)-Phe-OH + Peptide 5 or Boc-Phe-Phe-OH |
| Peptide sequence | FF |
| N-Terminal Modification | 4-azido |
| C-Terminal Modification | 4-azido |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide derivative |
| Technique | HR - SEM (High Resolution - Scanning Electron Microscopy), STEM (Scanning Transmission Electron Microscopy) and AFM (Atomic Force Microscopy) |
| Solvent | 50% ethanol |
| Method | To co-assemble the peptides, both peptides dissolved individually in HFP to a concentration of 100mg/ml. The desired combination of peptides was blended by mixing the peptides in HFP in the desired ratio to form a combination stock solution. The peptide combination stock solution was then diluted to a desired final concentration. peptide solution kept in dark at room temperature for 24 hours. |
| Conc | 5mg/ml of peptide 3, and 3mg/ml of peptide 5 |
| Temperature | Room temperature |
| Incubation Time | 24 hours |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Aggregate of tubular structure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| Co-assembly | |
| NA | |
| Others | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1466, |
| PMID | 24889029 |
| Peptide Name | Peptide 2 or H-Phe-Phe(4-azido)-OH + Peptide 5 or Boc-Phe-Phe-OH |
| Peptide sequence | FF |
| N-Terminal Modification | 4-azido |
| C-Terminal Modification | 4-azido |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide derivative |
| Technique | HR - SEM (High Resolution - Scanning Electron Microscopy), STEM (Scanning Transmission Electron Microscopy) and AFM (Atomic Force Microscopy) |
| Solvent | 50% ethanol |
| Method | To co-assemble the peptides, both peptides dissolved individually in HFP to a concentration of 100mg/ml. The desired combination of peptides was blended by mixing the peptides in HFP in the desired ratio to form a combination stock solution. The peptide combination stock solution was then diluted to a desired final concentration. peptide solution kept in dark at room temperature for 24 hours. |
| Conc | 5mg/ml of peptide 2, and 3mg/ml of peptide 5 |
| Temperature | Room temperature |
| Incubation Time | 24 hours |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Fused and flat spheres |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| Co-assembly | |
| NA | |
| Nanosphere | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1467, |
| PMID | 24889029 |
| Peptide Name | Peptide 3 or H-Phe(4-azido)-Phe-OH+ Peptide 4 or H-Phe-Phe-OH + Peptide 5 or Boc-Phe-Phe-OH |
| Peptide sequence | FF |
| N-Terminal Modification | 4-azido |
| C-Terminal Modification | 4-azido |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide derivative |
| Technique | HR - SEM (High Resolution - Scanning Electron Microscopy), STEM (Scanning Transmission Electron Microscopy) and AFM (Atomic Force Microscopy) |
| Solvent | 50% ethanol |
| Method | To co-assemble the peptides, both peptides dissolved individually in HFP to a concentration of 100mg/ml. The desired combination of peptides was blended by mixing the peptides in HFP in the desired ratio to form a combination stock solution. The peptide combination stock solution was then diluted to a desired final concentration. peptide solution kept in dark at room temperature for 24 hours. |
| Conc | 0.3mg/ml, 5mg/ml of peptide 4, and 3mg/ml of peptide 5 |
| Temperature | Room temperature |
| Incubation Time | 24 hours |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Necklace like Nanostructure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| Co-assembly | |
| Unstable | |
| Others | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1481, |
| PMID | 22651803 |
| Peptide Name | Dipeptide9 |
| Peptide sequence | FF |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy) and X - Ray Diffraction |
| Solvent | Water + 0.1 M NaOH |
| Method | 25mg of dipeptide was suspended in deionized 5ml water . An equimolar amount of NaOH (0.1 M,aq) was added, and the solution was gently stirred until a clear solution was formed. Glucono-δ- lactone (GdL) was added to the solution and the samples were gently swirled to dissolve the GdL before being left to stand for 24 h without stirring to form gel. |
| Conc | 5mg/ml or 0.5%wt |
| Temperature | Room temperature |
| Incubation Time | 24 hours |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Transparent or clear gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1486, |
| PMID | 22651803 |
| Peptide Name | Dipeptide18 |
| Peptide sequence | FF |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Technique | SEM (Scanning Electron Microscopy) and X - Ray Diffraction |
| Solvent | Water + 0.1 M NaOH |
| Method | 25mg of dipeptide was suspended in deionized 5ml water . An equimolar amount of NaOH (0.1 M,aq) was added, and the solution was gently stirred until a clear solution was formed. Glucono-δ- lactone (GdL) was added to the solution and the samples were gently swirled to dissolve the GdL before being left to stand for 24 h without stirring to form gel. |
| Conc | 5mg/ml or 0.5%wt |
| Temperature | Room temperature |
| Incubation Time | 24 hours |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Transparent or clear gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1494, |
| PMID | 19893524 |
| Peptide Name | cyclo-Phe-Phe |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | SEM (Scanning Electron Microscopy) |
| Method | 1 mg of diphenylalanine peptide lyophilized powder was placed in a small copper boat to serve as the source material. The substrate was placed above the source at a vertical distance of 2 cm. The chamber was then set to 220°C with a heating rate of 10°C per 2min at a constant pressure of 1X10 5mbar. Control of ADNT thickness was achieved by varying the deposition time. |
| Conc | 1mg lyophilized powder |
| Temperature | 220°C |
| Incubation Time | 2 - 10 minutes |
| Year | 2009 |
| Self assembly | Yes |
| Type of Self assembly | Vertical Nanotube |
| Tertiary Structure (Technique) | Not Predicted), |
| Cyclic | |
| NA | |
| Proteolytically stable | |
| Nanotube | |
| 40000 | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1495, |
| PMID | 19893524 |
| Peptide Name | cyclo-D-Phe-D-Phe |
| Peptide sequence | ff |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | SEM (Scanning Electron Microscopy) |
| Method | 1 mg of diphenylalanine peptide lyophilized powder was placed in a small copper boat to serve as the source material. The substrate was placed above the source at a vertical distance of 2 cm. The chamber was then set to 220°C with a heating rate of 10°C per 2min at a constant pressure of 1X10 5mbar. Control of ADNT thickness was achieved by varying the deposition time. |
| Conc | 1mg lyophilized powder |
| Temperature | 220°C |
| Incubation Time | 2 - 10 minutes |
| Year | 2009 |
| Self assembly | Yes |
| Type of Self assembly | Vertical Nanotube |
| Tertiary Structure (Technique) | Not Predicted), |
| Cyclic | |
| NA | |
| Proteolytically stable | |
| Nanotube | |
| 40000 | |
| ff | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1499, |
| PMID | 19198495 |
| Peptide Name | Phe-Phe |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | FE - SEM (Field Emission Scanning Electron Microscopy) |
| Solvent | Water |
| Method | Dipeptide dissolved by sonicating for 20 min, subsequently stirring it with a magnetic bar at 60°C and on cooling to room temperature, nanostructures were formed |
| Conc | 4mg/ml |
| Temperature | Room temperature |
| Year | 2008 |
| Self assembly | Yes |
| Type of Self assembly | Nanotube |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanotube | |
| 100 | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)CO | |
| Primary information | |
| SAPdb ID | 1500, |
| PMID | 19198495 |
| Peptide Name | Phe-Phe |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | FE - SEM (Field Emission Scanning Electron Microscopy) |
| Solvent | Methanol |
| Method | Dipeptide dissolved by sonicating for 20 min, subsequently stirring it with a magnetic bar at 60°C and on cooling to room temperature, nanostructures were formed |
| Conc | 10mg/ml |
| Temperature | Room temperature |
| Year | 2008 |
| Self assembly | Yes |
| Type of Self assembly | Nanoribbon |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanoribbon | |
| NA | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1501, |
| PMID | 19198495 |
| Peptide Name | Phe-Phe |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | FE - SEM (Field Emission Scanning Electron Microscopy) |
| Solvent | Ethanol |
| Method | Dipeptide dissolved by sonicating for 20 min, subsequently stirring it with a magnetic bar at 60°C and on cooling to room temperature, nanostructures were formed |
| Conc | 10mg/ml |
| Temperature | Room temperature |
| Year | 2008 |
| Self assembly | Yes |
| Type of Self assembly | Nanoribbon |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanoribbon | |
| NA | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1502, |
| PMID | 19198495 |
| Peptide Name | Phe-Phe |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | FE - SEM (Field Emission Scanning Electron Microscopy) |
| Solvent | Dichloromethane |
| Method | Dipeptide dissolved by sonicating for 20 min, subsequently stirring it with a magnetic bar at 60°C and on cooling to room temperature, nanostructures were formed |
| Conc | 4mg/ml |
| Temperature | Room temperature |
| Year | 2008 |
| Self assembly | Yes |
| Type of Self assembly | Nanoribbon and Nanowires |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanoribbon, Nanowires | |
| 550 | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1503, |
| PMID | 20050040 |
| Peptide Name | Hydrogelator 1 (Nap-L-Phe-L-Phe) |
| Peptide sequence | FF |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water |
| Method | 10 mg of the hydrogelator dissolves readily in 1.0 mL of pure water at pH = 10, and the hydrogel forms upon adjusting the pH of the solution back to around 7 |
| Conc | 10mg/ml |
| Temperature | 7.5 |
| Temperature | Room temperature |
| Year | 2009 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel (consists of fibers) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable at room temperature atleast for one month | |
| Hydrogel | |
| 10000 | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1504, |
| PMID | 20050040 |
| Peptide Name | Hydrogelator 2 (Nap-D-Phe-D-Phe) |
| Peptide sequence | ff |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water |
| Method | 10 mg of the hydrogelator dissolves readily in 1.0 mL of pure water at pH = 10, and the hydrogel forms upon adjusting the pH of the solution back to around 7 |
| Conc | 10mg/ml |
| Temperature | 7.5 |
| Temperature | Room temperature |
| Year | 2009 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel (consists of fibers) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable at room temperature atleast for one month | |
| Hydrogel | |
| NA | |
| ff | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1508, |
| PMID | 20356006 |
| Peptide Name | Phe-Phe |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | FE - SEM (Field Emission Scanning Electron Microscopy) |
| Solvent | Water + toluene |
| Method | 10 mg of peptide dissolved in 2 mL of water at 50 °C followed byr sonication, and 2 mL of toluene was added to form an organic layer above the water layer. After 10 min, a thin white film formed at the interface. The film was lifted onto quartz or Si substrate for characterization. Time period can be incresded to obtain more denser aggregation. |
| Conc | 5mg/ml |
| Temperature | 50°C for sonication |
| Incubation Time | 10 minutes |
| Year | 2009 |
| Self assembly | Yes |
| Type of Self assembly | Fibril |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable at upto 350°C | |
| Nanofibers | |
| 22500 | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1509, |
| PMID | 20356006 |
| Peptide Name | Phe-Phe |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | FE - SEM (Field Emission Scanning Electron Microscopy) |
| Solvent | Water + toluene |
| Method | 10 mg of peptide dissolved in 2 mL of water at 50 °C followed byr sonication, and 2 mL of toluene was added to form an organic layer above the water layer. After 10 min, a thin white film formed at the interface. The film was lifted onto quartz or Si substrate for characterization. Time period can be incresded to obtain more denser aggregation. |
| Conc | 5mg/ml |
| Temperature | 50°C for sonication |
| Incubation Time | 150 minutes |
| Year | 2009 |
| Self assembly | Yes |
| Type of Self assembly | Fibril |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable at upto 350°C | |
| Nanofibers | |
| 90000 | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1510, |
| PMID | 20461244 |
| Peptide Name | Peptide-I |
| Peptide sequence | FF |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Solvent | Water + NaOH + 3.75 mg/ml GdL(glucono-delta-lactone) |
| Method | Addition of NaOH to an aqueous suspension of the dipeptide followed by addition of 3.75 mg mL 1 of GdL resulted in the formation of a transparent gel |
| Conc | 2.2mM |
| Incubation Time | 15 minutes |
| Year | 2010 |
| Self assembly | Yes |
| Type of Self assembly | Transparent hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1518, |
| PMID | 20695592 |
| Peptide Name | Dipeptide 6 |
| Peptide sequence | FF |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water + NaOH + 8.75 mg/ml GdL(glucono-delta-lactone) |
| Method | Dipeptide solution mixed with equimolar solution of 0.1M NaOH followd by gentle stirring for 30 minutes to obtain clear solution. Then to lower the pH GdL is added and kept it undisturbed for 24 hours to get gel. |
| Conc | 0.5%wt |
| Temperature | 3.4 +/- 0.2. |
| Temperature | Room temperature |
| Incubation Time | > 24 hours |
| Year | 2010 |
| Self assembly | Yes |
| Type of Self assembly | Transparent gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Hydrogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1524, |
| PMID | 20695592 |
| Peptide Name | Dipeptide 12 |
| Peptide sequence | FF |
| N-Terminal Modification | Bromo-Napthalene or napthalene derivative |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water + NaOH + 8.75 mg/ml GdL(glucono-delta-lactone) |
| Method | Dipeptide solution mixed with equimolar solution of 0.1M NaOH followd by gentle stirring for 30 minutes to obtain clear solution. Then to lower the pH GdL is added and kept it undisturbed for 24 hours to get gel. |
| Conc | 0.5%wt |
| Temperature | 3.4 +/- 0.2. |
| Temperature | Room temperature |
| Incubation Time | > 24 hours |
| Year | 2010 |
| Self assembly | Yes |
| Type of Self assembly | Transparent gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Hydrogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1530, |
| PMID | 20695592 |
| Peptide Name | Dipeptide 18 |
| Peptide sequence | FF |
| N-Terminal Modification | Cyano-Napthalene or napthalene derivative |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water + NaOH + 8.75 mg/ml GdL(glucono-delta-lactone) |
| Method | Dipeptide solution mixed with equimolar solution of 0.1M NaOH followd by gentle stirring for 30 minutes to obtain clear solution. Then to lower the pH GdL is added and kept it undisturbed for 24 hours to get gel. |
| Conc | 0.5%wt |
| Temperature | 3.4 +/- 0.2. |
| Temperature | Room temperature |
| Incubation Time | > 24 hours |
| Year | 2010 |
| Self assembly | Yes |
| Type of Self assembly | Transparent gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Hydrogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1535, |
| PMID | 20958029 |
| Peptide Name | FF |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | SEM (Scanning Electron Microscopy) and AFM (Atomic force Microscopy) |
| Solvent | HFIP (1,1,1,3,3,3-hexafluoro-2-Isopropanol) + Methanol |
| Method | Peptide dissolved in HFIP at a concentration of 100 mg/mL which further diluted to 2mg/ml in DD Water to form self assembled structure |
| Conc | 2 - 10mg/ml |
| Year | 2010 |
| Self assembly | Yes |
| Type of Self assembly | PQD (Peptide quantum dots) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Others | |
| 2.12 | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1536, |
| PMID | 20958029 |
| Peptide Name | FF |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | SEM (Scanning Electron Microscopy) and AFM (Atomic force Microscopy) |
| Solvent | HFIP (1,1,1,3,3,3-hexafluoro-2-Isopropanol) + water |
| Method | Peptide dissolved in HFIP at a concentration of 100 mg/mL which further diluted to 2mg/ml in DD Water to form self assembled structure |
| Conc | 2-5 mg/ml |
| Year | 2010 |
| Self assembly | Yes |
| Type of Self assembly | Nanotube |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanotube | |
| 50 | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1538, |
| PMID | 21132174 |
| Peptide Name | Diphenylalanine |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | HFIP (1,1,1,3,3,3-hexafluoro-2-Isopropanol) + water |
| Method | The stock solution was prepared by dissolving the FF peptide powder in HFP and further with Distilled water to get final conc 2mg/ml and kept for 1day to form nanotube. |
| Conc | 2mg/ml |
| Temperature | pH 5-6 |
| Incubation Time | 24 hours or a day |
| Year | 2010 |
| Self assembly | Yes |
| Type of Self assembly | Nanotube |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable in acetonitrile and PBS | |
| Nanotube | |
| NA | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1539, |
| PMID | 21107375 |
| Peptide Name | Dipeptide 1 |
| Peptide sequence | FF |
| N-Terminal Modification | Fmoc(fluorenylmethoxycarbonyl) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | AFM (Atomic Force Microscopy) and DLS (Dynamic Light Scattering) |
| Solvent | Sodium phosphate buffer (pH 8) |
| Method | Peptide was dissolved in a 1 ml volume of 100 mM sodium phosphate buffer (pH 8) in the presence of varying concentrations of subtilisin (1.25–60.0 ml). The mixture was vortexed (30 s) and sonicated on ice for 20 min , and the low temperature ensures that no enzymatic conversion occurs up to this point. This was followed by heating,ceither in an oil bath or within the spectrophotometer using a temperature-controlled cuvet, at 55° for 60 min to allow enzymatic conversion to occur. The self-assembling system was then allowed to cool to room temperature. The gel samples were then left to stand for periods of 72 h. |
| Conc | 10 mmol/kg |
| Temperature | 8 |
| Temperature | Intial 55°C heating for 1 hour and followed by cooling at room temperature |
| Incubation Time | 72 hour |
| Year | 2010 |
| Self assembly | Yes |
| Type of Self assembly | Transparent gel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Hydrogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1547, |
| PMID | 21221462 |
| Peptide Name | Phe-Phe |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy) and DLS (Dynamic Light scattering) |
| Solvent | HFP (1,1,1,3,3,3-hexafluoro-2-propanol) + water |
| Method | 1mg of a purified peptide in 50 ml of HFIP and by subsequent addition of 1 ml of double distilled water. Samples were aged for 2– 24 hours. |
| Conc | 1 mg/ml |
| Temperature | Room temperature |
| Incubation Time | 2 -24 hours |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Nanotube |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Thermally stable < 63°C | |
| Nanotube | |
| 45 | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1555, |
| PMID | 21612897 |
| Peptide Name | Fmoc-FF |
| Peptide sequence | FF |
| N-Terminal Modification | Fmoc(fluorenylmethoxycarbonyl) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | AFM (Atomic Force Microscopy) |
| Solvent | Aqeous solution of HCl (pH ~4) |
| Conc | 0.8 - 2 mg/ml |
| Temperature | pH 2 -4 |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Nanorods |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanorod | |
| 20 | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1559, |
| PMID | 21879773 |
| Peptide Name | Phe-Phe |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Ethanol |
| Method | Dipeptide was freshly prepared by dissolving the peptides in ethanol at a concentration of 2 or 4 mg/mL at 70 C for 10 min and cooled to room temperature. Each peptide solution (100 μL) was then placed r modified surfaces i.e, silicon surface and dried at ambient temperature until the solvent evaporated. |
| Conc | 2 mg/ml |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Tubular structure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanotube | |
| NA | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1560, |
| PMID | 21879773 |
| Peptide Name | Phe-Phe |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Ethanol |
| Method | Dipeptide was freshly prepared by dissolving the peptides in ethanol at a concentration of 2 or 4 mg/mL at 70 C for 10 min and cooled to room temperature. Each peptide solution (100 μL) was then placed r modified surfaces i.e, silicon surface and dried at ambient temperature until the solvent evaporated. |
| Conc | 4mg/ml |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Flower like morphology |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Others | |
| NA | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1561, |
| PMID | 21879773 |
| Peptide Name | Phe-Phe |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Ethanol |
| Method | Dipeptide was freshly prepared by dissolving the peptides in ethanol at a concentration of 2 or 4 mg/mL at 70 C for 10 min and cooled to room temperature. Each peptide solution (100 μL) was then placed r modified surfaces i.e, AAO surface and dried at ambient temperature until the solvent evaporated. |
| Conc | 2 mg/ml |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Tubular and ribbon like morphology |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanotube, Nanoribbon | |
| NA | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1562, |
| PMID | 21879773 |
| Peptide Name | Phe-Phe |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Ethanol |
| Method | Dipeptide was freshly prepared by dissolving the peptides in ethanol at a concentration of 2 or 4 mg/mL at 70 C for 10 min and cooled to room temperature. Each peptide solution (100 μL) was then placed r modified surfaces i.e, AAO surface and dried at ambient temperature until the solvent evaporated. |
| Conc | 4mg/ml |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Flower like morphology |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Others | |
| NA | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1563, |
| PMID | 21879773 |
| Peptide Name | Phe-Phe |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Ethanol |
| Method | Dipeptide was freshly prepared by dissolving the peptides in ethanol at a concentration of 2 or 4 mg/mL at 70 C for 10 min and cooled to room temperature. Each peptide solution (100 μL) was then placed r modified surfaces i.e, PPX films with columnar morphologies and dried at ambient temperature until the solvent evaporated. |
| Conc | 2 - 4mg/ml |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Flakelike peptidic Nanostructures |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Others | |
| NA | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1564, |
| PMID | 21879773 |
| Peptide Name | Phe-Phe |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Ethanol |
| Method | Dipeptide was freshly prepared by dissolving the peptides in ethanol at a concentration of 2 or 4 mg/mL at 70 C for 10 min and cooled to room temperature. Each peptide solution (100 μL) was then placed r modified surfaces i.e, PPX films with helical morphologies and dried at ambient temperature until the solvent evaporated. |
| Conc | 2 - 4mg/ml |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Transparent thin films |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Others | |
| 200 | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1565, |
| PMID | 21948432 |
| Peptide Name | 1A |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate (Nucleopeptide) |
| Conjugate partner | Nucleobase |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water |
| Method | Peptide that self-assemble in water to form nanofibers and produce hydrogels at a concentration of 2.0 wt% and a pH value around 5 |
| Conc | 2 %wt |
| Temperature | 5 |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Hydogel (consists of fibers) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| 16 | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1566, |
| PMID | 21948432 |
| Peptide Name | 1G |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate (Nucleopeptide) |
| Conjugate partner | Nucleobase |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water |
| Method | Peptide that self-assemble in water to form nanofibers and produce hydrogels at a concentration of 2.0 wt% and a pH value around 5 |
| Conc | 2 %wt |
| Temperature | 5 |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Hydogel (consists of fibers) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| 15 | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1567, |
| PMID | 21948432 |
| Peptide Name | 1T |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate (Nucleopeptide) |
| Conjugate partner | Nucleobase |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water |
| Method | Peptide that self-assemble in water to form nanofibers and produce hydrogels at a concentration of 2.0 wt% and a pH value around 5 |
| Conc | 2 %wt |
| Temperature | 5 |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Hydogel (consists of fibers) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Hydrogel | |
| 9 | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1568, |
| PMID | 21948432 |
| Peptide Name | 1C |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate (Nucleopeptide) |
| Conjugate partner | Nucleobase |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water |
| Method | Peptide that self-assemble in water to form nanofibers and produce hydrogels at a concentration of 2.0 wt% and a pH value around 5 |
| Conc | 2 %wt |
| Temperature | 5 |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Hydogel (consists of fibers) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| 10 | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1569, |
| PMID | 21948432 |
| Peptide Name | 3A |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate (Nucleopeptide) |
| Conjugate partner | Nucleobase |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water |
| Method | Peptide that self-assemble in water to form nanofibers and produce hydrogels at a concentration of 2.0 wt% and a pH value around 7.4 |
| Conc | 2 %wt |
| Temperature | 7.4 |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Hydogel (consists of fibers) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| 20 | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1570, |
| PMID | 21948432 |
| Peptide Name | 3G |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate (Nucleopeptide) |
| Conjugate partner | Nucleobase |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water |
| Method | Peptide that self-assemble in water to form nanofibers and produce hydrogels at a concentration of 2.0 wt% and a pH value around 7.4 |
| Conc | 2 %wt |
| Temperature | 7.4 |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Hydogel (consists of fibers) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| 14 | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1571, |
| PMID | 21948432 |
| Peptide Name | 3T |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate (Nucleopeptide) |
| Conjugate partner | Nucleobase |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water |
| Method | Peptide that self-assemble in water to form nanofibers and produce hydrogels at a concentration of 2.0 wt% and a pH value around 7.4 |
| Conc | 2 %wt |
| Temperature | 7.4 |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Hydogel (consists of fibers) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Hydrogel | |
| 9 | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1572, |
| PMID | 21948432 |
| Peptide Name | 3C |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate (Nucleopeptide) |
| Conjugate partner | Nucleobase |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water |
| Method | Peptide that self-assemble in water to form nanofibers and produce hydrogels at a concentration of 2.0 wt% and a pH value around 7.4 |
| Conc | 2 %wt |
| Temperature | 7.4 |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Hydogel (consists of fibers) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| 5 | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1579, |
| PMID | 22005767 |
| Peptide Name | Peptide 2 |
| Peptide sequence | FF |
| N-Terminal Modification | Napthalene-nitrile |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Cryo - TEM (Transmission Electron Microscopy) |
| Solvent | Water + GdL(glucono-delta-lactone) + Calcium nitrate |
| Method | 0.5wt% dipeptide solution was prepared by adding 200 mg dipeptide into water. The pH was adjusted to 11.7 with the addition of NaOH (1.0 M) solution into the stock solution to form a transparent, viscous solution after mild stirring for 2 hours. To the dipeptide stock solution, 200mg/ml salt solution added and final solution left to stand overnight. Transparent gels were formed |
| Conc | 0.5 % wt |
| Temperature | 11.7 |
| Incubation Time | 90 minutes |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1580, |
| PMID | 22005767 |
| Peptide Name | Peptide 1 |
| Peptide sequence | FF |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Cryo - TEM (Transmission Electron Microscopy) |
| Solvent | Water + GdL(glucono-delta-lactone) + Calcium nitrate |
| Method | 0.5wt% dipeptide solution was prepared by adding 200 mg dipeptide into water. The pH was adjusted to 11.7 with the addition of NaOH (1.0 M) solution into the stock solution to form a transparent, viscous solution after mild stirring for 2 hours. To the dipeptide stock solution,200mg/ml salt solution added andfinal solution left to stand overnight. Transparent gels were formed |
| Conc | 0.5 % wt |
| Temperature | 11.7 |
| Incubation Time | 90 minutes |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1581, |
| PMID | 22005767 |
| Peptide Name | Peptide 1 |
| Peptide sequence | FF |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Cryo - TEM (Transmission Electron Microscopy) |
| Solvent | Water + GdL(glucono-delta-lactone) + Sodium chloride |
| Method | 0.5wt% dipeptide solution was prepared by adding 200 mg dipeptide into water. The pH was adjusted to 11.3 with the addition of NaOH (1.0 M) solution into the stock solution to form a transparent, viscous solution after mild stirring for 2 hours. To the dipeptide stock solution salt (GdL) solution added andfinal solution left to stand overnight. Transparent gels were formed |
| Conc | 0.5 % wt |
| Temperature | 11.3 |
| Incubation Time | 90 minutes |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1582, |
| PMID | 22005767 |
| Peptide Name | Peptide 1 |
| Peptide sequence | FF |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Cryo - TEM (Transmission Electron Microscopy) |
| Solvent | Water + GdL(glucono-delta-lactone) + Lithium chloride |
| Method | 0.5wt% dipeptide solution was prepared by adding 200 mg dipeptide into water. The pH was adjusted to 10.5 with the addition of NaOH (1.0 M) solution into the stock solution to form a transparent, viscous solution after mild stirring for 2 hours. To the dipeptide stock solution, 200mg/ml salt solution added andfinal solution left to stand overnight. Transparent gels were formed |
| Conc | 0.5 % wt |
| Temperature | 10.5 |
| Incubation Time | 90 minutes |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1583, |
| PMID | 22005767 |
| Peptide Name | Peptide 1 |
| Peptide sequence | FF |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Cryo - TEM (Transmission Electron Microscopy) |
| Solvent | Water + GdL(glucono-delta-lactone) + Lithium sulphate |
| Method | 0.5wt% dipeptide solution was prepared by adding 200 mg dipeptide into water. The pH was adjusted to 11.7 with the addition of NaOH (1.0 M) solution into the stock solution to form a transparent, viscous solution after mild stirring for 2 hours. To the dipeptide stock solution salt (GdL) solution added andfinal solution left to stand overnight. Transparent gels were formed |
| Conc | 0.5 % wt |
| Temperature | 11.7 |
| Incubation Time | 90 minutes |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1584, |
| PMID | 22005767 |
| Peptide Name | Peptide 1 |
| Peptide sequence | FF |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Cryo - TEM (Transmission Electron Microscopy) |
| Solvent | Water + GdL(glucono-delta-lactone) + sodium nitrate |
| Method | 0.5wt% dipeptide solution was prepared by adding 200 mg dipeptide into water. The pH was adjusted to 10.6 with the addition of NaOH (1.0 M) solution into the stock solution to form a transparent, viscous solution after mild stirring for 2 hours. To the dipeptide stock solution salt, 200mg/ml salt solution added andfinal solution left to stand overnight. Transparent gels were formed |
| Conc | 0.5 % wt |
| Temperature | 10.6 |
| Incubation Time | 90 minutes |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1585, |
| PMID | 22005767 |
| Peptide Name | Peptide 1 |
| Peptide sequence | FF |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Cryo - TEM (Transmission Electron Microscopy) |
| Solvent | Water + GdL(glucono-delta-lactone) + potassium chloride |
| Method | 0.5wt% dipeptide solution was prepared by adding 200 mg dipeptide into water. The pH was adjusted to 11.7 with the addition of NaOH (1.0 M) solution into the stock solution to form a transparent, viscous solution after mild stirring for 2 hours. To the dipeptide stock solution, 200mg/ml salt solution added andfinal solution left to stand overnight. Transparent gels were formed |
| Conc | 0.5 % wt |
| Temperature | 11.7 |
| Incubation Time | 90 minutes |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1586, |
| PMID | 22005767 |
| Peptide Name | Peptide 1 |
| Peptide sequence | FF |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Cryo - TEM (Transmission Electron Microscopy) |
| Solvent | Water + GdL(glucono-delta-lactone) + Ammonium acetate |
| Method | 0.5wt% dipeptide solution was prepared by adding 200 mg dipeptide into water. The pH was adjusted to 8.8 with the addition of NaOH (1.0 M) solution into the stock solution to form a transparent, viscous solution after mild stirring for 2 hours. To the dipeptide stock solution salt (GdL) solution added andfinal solution left to stand overnight. Transparent gels were formed |
| Conc | 0.5 % wt |
| Temperature | 8.8 |
| Incubation Time | 90 minutes |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1587, |
| PMID | 22005767 |
| Peptide Name | Peptide 1 |
| Peptide sequence | FF |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Cryo - TEM (Transmission Electron Microscopy) |
| Solvent | Water + GdL(glucono-delta-lactone) + Ammonium chloride |
| Method | 0.5wt% dipeptide solution was prepared by adding 200 mg dipeptide into water. The pH was adjusted to 8.7 with the addition of NaOH (1.0 M) solution into the stock solution to form a transparent, viscous solution after mild stirring for 2 hours. To the dipeptide stock solution, 200mg/ml salt solution added andfinal solution left to stand overnight. Transparent gels were formed |
| Conc | 0.5 % wt |
| Temperature | 8.7 |
| Incubation Time | 90 minutes |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1588, |
| PMID | 22005767 |
| Peptide Name | Peptide 1 |
| Peptide sequence | FF |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Cryo - TEM (Transmission Electron Microscopy) |
| Solvent | Water + GdL(glucono-delta-lactone) + Sodium acetate |
| Method | 0.5wt% dipeptide solution was prepared by adding 200 mg dipeptide into water. The pH was adjusted to 11.6 with the addition of NaOH (1.0 M) solution into the stock solution to form a transparent, viscous solution after mild stirring for 2 hours. To the dipeptide stock solution, 200mg/ml salt solution added andfinal solution left to stand overnight. Transparent gels were formed |
| Conc | 0.5 % wt |
| Temperature | 11.6 |
| Incubation Time | 90 minutes |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1589, |
| PMID | 22005767 |
| Peptide Name | Peptide 1 |
| Peptide sequence | FF |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Cryo - TEM (Transmission Electron Microscopy) |
| Solvent | Water + GdL(glucono-delta-lactone) + Magnesium sulphate |
| Method | 0.5wt% dipeptide solution was prepared by adding 200 mg dipeptide into water. The pH was adjusted to 10.2 with the addition of NaOH (1.0 M) solution into the stock solution to form a transparent, viscous solution after mild stirring for 2 hours. To the dipeptide stock solution, 6mg/ml salt solution added andfinal solution left to stand overnight. Transparent gels were formed |
| Conc | 0.5 % wt |
| Temperature | 10.2 |
| Incubation Time | 90 minutes |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1590, |
| PMID | 22005767 |
| Peptide Name | Peptide 1 |
| Peptide sequence | FF |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Cryo - TEM (Transmission Electron Microscopy) |
| Solvent | Water + GdL(glucono-delta-lactone) + calcium chloride |
| Method | 0.5wt% dipeptide solution was prepared by adding 200 mg dipeptide into water. The pH was adjusted to 11.3 with the addition of NaOH (1.0 M) solution into the stock solution to form a transparent, viscous solution after mild stirring for 2 hours. To the dipeptide stock solution salt (GdL) solution added andfinal solution left to stand overnight. Transparent gels were formed |
| Conc | 0.5 % wt |
| Temperature | 11.3 |
| Incubation Time | 90 minutes |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1591, |
| PMID | 22005767 |
| Peptide Name | Peptide 1 |
| Peptide sequence | FF |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Cryo - TEM (Transmission Electron Microscopy) |
| Solvent | Water + GdL(glucono-delta-lactone) + Magnesium nitrate |
| Method | 0.5wt% dipeptide solution was prepared by adding 200 mg dipeptide into water. The pH was adjusted to 9.9 with the addition of NaOH (1.0 M) solution into the stock solution to form a transparent, viscous solution after mild stirring for 2 hours. To the dipeptide stock solution salt (GdL) solution added andfinal solution left to stand overnight. Transparent gels were formed |
| Conc | 0.5 % wt |
| Temperature | 9.9 |
| Incubation Time | 90 minutes |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1592, |
| PMID | 22005767 |
| Peptide Name | Peptide 1 |
| Peptide sequence | FF |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Cryo - TEM (Transmission Electron Microscopy) |
| Solvent | Water + GdL(glucono-delta-lactone) + Magnesium Chloride |
| Method | 0.5wt% dipeptide solution was prepared by adding 200 mg dipeptide into water. The pH was adjusted to 9.7 with the addition of NaOH (1.0 M) solution into the stock solution to form a transparent, viscous solution after mild stirring for 2 hours. To the dipeptide stock solution salt (GdL) solution added andfinal solution left to stand overnight. Transparent gels were formed |
| Conc | 0.5 % wt |
| Temperature | 9.7 |
| Incubation Time | 90 minutes |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1593, |
| PMID | 22005767 |
| Peptide Name | Peptide 1 |
| Peptide sequence | FF |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Cryo - TEM (Transmission Electron Microscopy) |
| Solvent | Water + GdL(glucono-delta-lactone) + potassium chloride |
| Method | 0.5wt% dipeptide solution was prepared by adding 200 mg dipeptide into water. The pH was adjusted to 11.7 with the addition of NaOH (1.0 M) solution into the stock solution to form a transparent, viscous solution after mild stirring for 2 hours. To the dipeptide stock solution salt (GdL) solution added andfinal solution left to stand overnight. Transparent gels were formed |
| Conc | 0.5 % wt |
| Temperature | 11.7 |
| Incubation Time | 90 minutes |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1595, |
| PMID | 22037699 |
| Peptide Name | Gelator 1 |
| Peptide sequence | FF |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water |
| Method | N-terminated dipeptide self-assemble into supramolecular nanofibers in water to form stable hydrogels with the concentration of less than 0.8 wt% and within a relatively narrow pH range (pH = 5.0–6.0). |
| Conc | 0.8 %wt |
| Temperature | < 5 |
| Year | 2011 |
| Self assembly | No |
| Type of Self assembly | No assembled structure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| None | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1596, |
| PMID | 22037699 |
| Peptide Name | Gelator 2 |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Napthalene |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water |
| Method | N-terminated dipeptide self-assemble into supramolecular nanofibers in water to form stable hydrogels with the concentration of less than 0.8 wt% and within a relatively narrow pH range (pH = 5.0–6.0). |
| Conc | 0.8 %wt |
| Temperature | ~ 5 - 6 |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel (Consists of Fibers) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Hydrogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1597, |
| PMID | 22037699 |
| Peptide Name | Gelator 3 |
| Peptide sequence | FF |
| N-Terminal Modification | Amino-Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water |
| Method | N-terminated dipeptide self-assemble into supramolecular nanofibers in water to form stable hydrogels with the concentration of less than 0.8 wt% and within a relatively narrow pH range (pH = 5.0–6.0). |
| Conc | 0.8 %wt |
| Temperature | > 6 |
| Year | 2011 |
| Self assembly | No |
| Type of Self assembly | No assembled structure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| None | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1598, |
| PMID | 22037699 |
| Peptide Name | Gelator 2 |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Napthalene |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water |
| Method | N-terminated dipeptide self-assemble into supramolecular nanofibers in water to form stable hydrogels with the concentration of less than 0.8 wt% and within a relatively narrow pH range (pH = 5.0–6.0). |
| Conc | 0.012 |
| Temperature | ~ 5 - 6 |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Hydrogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1599, |
| PMID | 22037699 |
| Peptide Name | Gelator 3 |
| Peptide sequence | FF |
| N-Terminal Modification | Amino-Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water |
| Method | N-terminated dipeptide self-assemble into supramolecular nanofibers in water to form stable hydrogels with the concentration of less than 0.8 wt% and within a relatively narrow pH range (pH = 5.0–6.0). |
| Conc | 0.012 |
| Temperature | ~ 5 - 6 |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Hydrogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1600, |
| PMID | 22129632 |
| Peptide Name | Fmoc-Phe-Phe |
| Peptide sequence | FF |
| N-Terminal Modification | Fmoc(fluorenylmethoxycarbonyl) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water + NaOH + GdL(glucono-delta-lactone) |
| Method | Dipeptide suspended in water and sonicated. NaOH (0.5 M) was added to the suspension until a solution was formed at conc. 15mM. To induce gelation, GdL was added as a powder to a concentration of 4–40 mM. The sample was quickly mixed stored at room temperature to form gel for 72 h. |
| Conc | 15mM |
| Temperature | 3 - 4 |
| Temperature | Room temperature |
| Incubation Time | 72 hour |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Mechanically less stable | |
| Hydrogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1601, |
| PMID | 22129632 |
| Peptide Name | Fmoc-Phe-Phe |
| Peptide sequence | FF |
| N-Terminal Modification | Fmoc(fluorenylmethoxycarbonyl) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Water + NaOH + GdL(glucono-delta-lactone) |
| Method | Dipeptide suspended in water and sonicated. NaOH (0.5 M) was added to the suspension until a solution was formed at conc. 15mM. To induce gelation, GdL was added as a powder to a concentration of 4–40 mM. The sample was quickly mixed stored at -12°C to form gel for 72 h. |
| Conc | 15mM |
| Temperature | 3 - 4 |
| Temperature | (-)12°C |
| Incubation Time | 72 hour |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Cryogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Others | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1610, |
| PMID | 21085503 |
| Peptide Name | Bis(PhePhe) or 5a |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy) |
| Solvent | Ethanol |
| Method | 10 mg peptide placed in a test tube, and the solvent was added by microsyringe in 100-500 µL portions. After each addition the mixture was gently heated until the substance dissolved, and was then allowed to cool spontaneously to room temperature and formation of gel. checked by test tube inversion. |
| Temperature | Room temperature |
| Incubation Time | Yes |
| Year | 2010 |
| Self assembly | Yes |
| Type of Self assembly | Entangled tiny fibers |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanofibers | |
| 13 | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1612, |
| PMID | 22534735 |
| Peptide Name | FF-nucleotide conjugate |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Nucleotide |
| Technique | TEM (Transmission Electron Microscopy) and AFM (Atomic Force Microscopy) |
| Solvent | Water |
| Method | Peptide was dissolved in water at a concentration of 2 mg/ml. this solution was then incubated for 2 h at 37 °C. |
| Conc | 2mg/ml |
| Temperature | 6.5 |
| Temperature | 37°C |
| Incubation Time | Yes |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Spherical structure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanosphere | |
| 250 | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1613, |
| PMID | 22534735 |
| Peptide Name | FF |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | TEM (Transmission Electron Microscopy) and AFM (Atomic Force Microscopy) |
| Solvent | Water |
| Method | Peptide was dissolved in water at a concentration of 2 mg/ml. this solution was then incubated for 2 h at 37 °C. |
| Conc | 2mg/ml |
| Temperature | 6.5 |
| Temperature | 37°C |
| Incubation Time | Yes |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Fibrillar structure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanofibers | |
| NA | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1614, |
| PMID | 22535547 |
| Peptide Name | Diphenylalanine mono-mannose conjugate |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Mannose |
| Technique | SEM (Scanning Electron Microscopy) and AFM (Atomic force Microscopy) |
| Solvent | Water |
| Method | Fresh solutions of glycopeptides (1mM) in appropriate solvents were prepared and incubated at 37°C for 24 hours to form self assembled structures. |
| Conc | 1mM |
| Temperature | 37°C |
| Incubation Time | 24 hours |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Tubular structure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanotube | |
| NA | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)CO | |
| Primary information | |
| SAPdb ID | 1615, |
| PMID | 22535547 |
| Peptide Name | Diphenylalanine bis-mannose conjugate |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Bis-Mannose linked through lys |
| Technique | SEM (Scanning Electron Microscopy) and AFM (Atomic force Microscopy) |
| Solvent | Water |
| Method | Fresh solutions of glycopeptides (1mM) in appropriate solvents were prepared and incubated at 37°C for 12 hours to form self assembled structures. |
| Conc | 1mM |
| Temperature | 37°C |
| Incubation Time | 12 hours |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Spherical structure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| More stable | |
| Nanosphere | |
| 600 | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1616, |
| PMID | 22535547 |
| Peptide Name | Thiolated -Diphenylalanine mono-mannose conjugate |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Mannose |
| Technique | SEM (Scanning Electron Microscopy) and AFM (Atomic force Microscopy) |
| Solvent | 50 % aqeous methanol |
| Method | Fresh solutions of glycopeptides (1mM) in appropriate solvents were prepared and incubated at 37°C for 24 hours to form self assembled structures. |
| Conc | 1mM |
| Temperature | 37°C |
| Incubation Time | 24 hours |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Spherical aggregate |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Less stable | |
| Others | |
| NA | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)CO | |
| Primary information | |
| SAPdb ID | 1617, |
| PMID | 18837544 |
| Peptide Name | Diphenylalanine |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | EFM (Electrostatic Force Microscopy) |
| Solvent | HFIP (1,1,1,3,3,3-hexafluoro-2-Isopropanol) + water |
| Method | The peptide solution was prepared by dissolving the lyophilized form of the diphenylalanine in 1,1,1,3,3,3-hexafluoro-2-propanol (HFIP) at a final concentration of 100 mg/mL. Peptide stock solution was diluted in distilled water to a final concentration of 2 mg/mL. |
| Conc | 2mg/ml |
| Year | 2008 |
| Self assembly | Yes |
| Type of Self assembly | Hollow fibers |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanotube | |
| 7 | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1624, |
| PMID | 24896538 |
| Peptide Name | Fmoc-FF |
| Peptide sequence | FF |
| N-Terminal Modification | Fmoc(fluorenylmethoxycarbonyl) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | SEM (Scanning Electron Microscopy) and AFM (Atomic force Microscopy) |
| Solvent | Phosphate buffer |
| Method | 10 mM Fmoc-FF solution was prepared by dissolving 5.32 mg of Fmoc-FF in 1 mL of phosphate buffer solution. Emulsion formed after hand-shaking for 5 s emulsions form in vials. Gel formed in 24 hours on incubation at room temperature. |
| Conc | 10mM |
| Temperature | 8 |
| Temperature | Room temperature |
| Incubation Time | 24 hours |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Gel (consist of Fibrous network) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| FF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1625, |
| PMID | 23795243 |
| Peptide Name | FF |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Insilico method: MARTINI coarse - grained molecular dynamic |
| Solvent | Water |
| Method | A simulation for each dipeptide (in their zwitterionic form) was set up using the GROMACS molecular dynamics package. A cubic box with 300 dipeptides, placed randomly with a minimum distance of 3 Å between them, was solvated in standard MARTINI CG water (four water molecules per bead) to a final concentration of ∼0.4 M. A Berendsen thermostat and barostat36 were used to keep the temperature at 303 K and pressure at 1 bar, respectively. Bond lengths in aromatic side chains and the backbone side-chain bonds in I, V, and Y were constrained using the LINCS algorithm.37 All boxes were energy minimized using the steepest descent integrator and then equilibrated for 4 106 time steps of 25 fs. The total screening simulation time equates to 100 ns, but because of the smoothness of the CG potentials, this roughly equates to an effective 400 ns of atomistic simulation time |
| Conc | 0.4M |
| Temperature | 30°C |
| Year | 2011 |
| Self assembly | Yes |
| Type of Self assembly | Tubes and Vesicles |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanotube, Nanovesicle | |
| NA | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1634, |
| PMID | 24895323 |
| Peptide Name | Diphenylalanine |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | ESEM (Environmental Scanning Electron Microscope) |
| Solvent | HFP (1,1,1,3,3,3-hexafluoro-2-propanol) |
| Method | FF-peptide nanotubes (PNT) were prepared by dissolving the L-diphenylalanine peptide in 1,1,1,3,3,3-hexafluoro-2-propanol an initial concentration of 100mg/ml further diluted in deionized water. Drops of the above solutions at a final concentrationof 2mg/ml were placed onto clean silicon substrates and dried at room temperature. The thermally induced PNT samples were heated in an oven for 180 min at 180 °C. |
| Conc | 2mg/ml |
| Temperature | Room temperature |
| Incubation Time | 180 minutes |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Nanotubes |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanotube | |
| NA | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |
| Primary information | |
| SAPdb ID | 1635, |
| PMID | 24895323 |
| Peptide Name | Diphenylalanine |
| Peptide sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | ESEM (Environmental Scanning Electron Microscope) |
| Solvent | HFP (1,1,1,3,3,3-hexafluoro-2-propanol) |
| Method | FF-peptide nanotubes (PNT) were prepared by dissolving the L-diphenylalanine peptide in 1,1,1,3,3,3-hexafluoro-2-propanol an initial concentration of 100mg/ml further diluted in deionized water. Drops of the above solutions at a final concentrationof 2mg/ml were placed onto clean silicon substrates and dried at room temperature. The thermally induced PNT samples were heated in an oven for 180 min at 180 °C. |
| Conc | 2mg/ml |
| Temperature | 180 °C |
| Incubation Time | >180 minutes |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Needle like wire -Nanofibril structure |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| Temperature induced | |
| NA | |
| Nanofibers, Nanowire | |
| NA | |
| FF | |
| N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |